ee8d661058
### What changes were proposed in this pull request? This PR proposes to move pandas related functionalities into pandas package. Namely: ```bash pyspark/sql/pandas ├── __init__.py ├── conversion.py # Conversion between pandas <> PySpark DataFrames ├── functions.py # pandas_udf ├── group_ops.py # Grouped UDF / Cogrouped UDF + groupby.apply, groupby.cogroup.apply ├── map_ops.py # Map Iter UDF + mapInPandas ├── serializers.py # pandas <> PyArrow serializers ├── types.py # Type utils between pandas <> PyArrow └── utils.py # Version requirement checks ``` In order to separately locate `groupby.apply`, `groupby.cogroup.apply`, `mapInPandas`, `toPandas`, and `createDataFrame(pdf)` under `pandas` sub-package, I had to use a mix-in approach which Scala side uses often by `trait`, and also pandas itself uses this approach (see `IndexOpsMixin` as an example) to group related functionalities. Currently, you can think it's like Scala's self typed trait. See the structure below: ```python class PandasMapOpsMixin(object): def mapInPandas(self, ...): ... return ... # other Pandas <> PySpark APIs ``` ```python class DataFrame(PandasMapOpsMixin): # other DataFrame APIs equivalent to Scala side. ``` Yes, This is a big PR but they are mostly just moving around except one case `createDataFrame` which I had to split the methods. ### Why are the changes needed? There are pandas functionalities here and there and I myself gets lost where it was. Also, when you have to make a change commonly for all of pandas related features, it's almost impossible now. Also, after this change, `DataFrame` and `SparkSession` become more consistent with Scala side since pandas is specific to Python, and this change separates pandas-specific APIs away from `DataFrame` or `SparkSession`. ### Does this PR introduce any user-facing change? No. ### How was this patch tested? Existing tests should cover. Also, I manually built the PySpark API documentation and checked. Closes #27109 from HyukjinKwon/pandas-refactoring. Authored-by: HyukjinKwon <gurwls223@apache.org> Signed-off-by: HyukjinKwon <gurwls223@apache.org>
650 lines
27 KiB
Python
650 lines
27 KiB
Python
#
|
|
# Licensed to the Apache Software Foundation (ASF) under one or more
|
|
# contributor license agreements. See the NOTICE file distributed with
|
|
# this work for additional information regarding copyright ownership.
|
|
# The ASF licenses this file to You under the Apache License, Version 2.0
|
|
# (the "License"); you may not use this file except in compliance with
|
|
# the License. You may obtain a copy of the License at
|
|
#
|
|
# http://www.apache.org/licenses/LICENSE-2.0
|
|
#
|
|
# Unless required by applicable law or agreed to in writing, software
|
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
# See the License for the specific language governing permissions and
|
|
# limitations under the License.
|
|
#
|
|
|
|
"""
|
|
Worker that receives input from Piped RDD.
|
|
"""
|
|
from __future__ import print_function
|
|
import os
|
|
import sys
|
|
import time
|
|
# 'resource' is a Unix specific module.
|
|
has_resource_module = True
|
|
try:
|
|
import resource
|
|
except ImportError:
|
|
has_resource_module = False
|
|
import traceback
|
|
|
|
from pyspark.accumulators import _accumulatorRegistry
|
|
from pyspark.broadcast import Broadcast, _broadcastRegistry
|
|
from pyspark.java_gateway import local_connect_and_auth
|
|
from pyspark.taskcontext import BarrierTaskContext, TaskContext
|
|
from pyspark.files import SparkFiles
|
|
from pyspark.resourceinformation import ResourceInformation
|
|
from pyspark.rdd import PythonEvalType
|
|
from pyspark.serializers import write_with_length, write_int, read_long, read_bool, \
|
|
write_long, read_int, SpecialLengths, UTF8Deserializer, PickleSerializer, \
|
|
BatchedSerializer
|
|
from pyspark.sql.pandas.serializers import ArrowStreamPandasUDFSerializer, CogroupUDFSerializer
|
|
from pyspark.sql.pandas.types import to_arrow_type
|
|
from pyspark.sql.types import StructType
|
|
from pyspark.util import _get_argspec, fail_on_stopiteration
|
|
from pyspark import shuffle
|
|
|
|
if sys.version >= '3':
|
|
basestring = str
|
|
else:
|
|
from itertools import imap as map # use iterator map by default
|
|
|
|
pickleSer = PickleSerializer()
|
|
utf8_deserializer = UTF8Deserializer()
|
|
|
|
|
|
def report_times(outfile, boot, init, finish):
|
|
write_int(SpecialLengths.TIMING_DATA, outfile)
|
|
write_long(int(1000 * boot), outfile)
|
|
write_long(int(1000 * init), outfile)
|
|
write_long(int(1000 * finish), outfile)
|
|
|
|
|
|
def add_path(path):
|
|
# worker can be used, so donot add path multiple times
|
|
if path not in sys.path:
|
|
# overwrite system packages
|
|
sys.path.insert(1, path)
|
|
|
|
|
|
def read_command(serializer, file):
|
|
command = serializer._read_with_length(file)
|
|
if isinstance(command, Broadcast):
|
|
command = serializer.loads(command.value)
|
|
return command
|
|
|
|
|
|
def chain(f, g):
|
|
"""chain two functions together """
|
|
return lambda *a: g(f(*a))
|
|
|
|
|
|
def wrap_udf(f, return_type):
|
|
if return_type.needConversion():
|
|
toInternal = return_type.toInternal
|
|
return lambda *a: toInternal(f(*a))
|
|
else:
|
|
return lambda *a: f(*a)
|
|
|
|
|
|
def wrap_scalar_pandas_udf(f, return_type):
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
def verify_result_type(result):
|
|
if not hasattr(result, "__len__"):
|
|
pd_type = "Pandas.DataFrame" if type(return_type) == StructType else "Pandas.Series"
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
"{}, but is {}".format(pd_type, type(result)))
|
|
return result
|
|
|
|
def verify_result_length(result, length):
|
|
if len(result) != length:
|
|
raise RuntimeError("Result vector from pandas_udf was not the required length: "
|
|
"expected %d, got %d" % (length, len(result)))
|
|
return result
|
|
|
|
return lambda *a: (verify_result_length(
|
|
verify_result_type(f(*a)), len(a[0])), arrow_return_type)
|
|
|
|
|
|
def wrap_pandas_iter_udf(f, return_type):
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
def verify_result_type(result):
|
|
if not hasattr(result, "__len__"):
|
|
pd_type = "Pandas.DataFrame" if type(return_type) == StructType else "Pandas.Series"
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
"{}, but is {}".format(pd_type, type(result)))
|
|
return result
|
|
|
|
return lambda *iterator: map(lambda res: (res, arrow_return_type),
|
|
map(verify_result_type, f(*iterator)))
|
|
|
|
|
|
def wrap_cogrouped_map_pandas_udf(f, return_type, argspec):
|
|
|
|
def wrapped(left_key_series, left_value_series, right_key_series, right_value_series):
|
|
import pandas as pd
|
|
|
|
left_df = pd.concat(left_value_series, axis=1)
|
|
right_df = pd.concat(right_value_series, axis=1)
|
|
|
|
if len(argspec.args) == 2:
|
|
result = f(left_df, right_df)
|
|
elif len(argspec.args) == 3:
|
|
key_series = left_key_series if not left_df.empty else right_key_series
|
|
key = tuple(s[0] for s in key_series)
|
|
result = f(key, left_df, right_df)
|
|
if not isinstance(result, pd.DataFrame):
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
"pandas.DataFrame, but is {}".format(type(result)))
|
|
if not len(result.columns) == len(return_type):
|
|
raise RuntimeError(
|
|
"Number of columns of the returned pandas.DataFrame "
|
|
"doesn't match specified schema. "
|
|
"Expected: {} Actual: {}".format(len(return_type), len(result.columns)))
|
|
return result
|
|
|
|
return lambda kl, vl, kr, vr: [(wrapped(kl, vl, kr, vr), to_arrow_type(return_type))]
|
|
|
|
|
|
def wrap_grouped_map_pandas_udf(f, return_type, argspec):
|
|
|
|
def wrapped(key_series, value_series):
|
|
import pandas as pd
|
|
|
|
if len(argspec.args) == 1:
|
|
result = f(pd.concat(value_series, axis=1))
|
|
elif len(argspec.args) == 2:
|
|
key = tuple(s[0] for s in key_series)
|
|
result = f(key, pd.concat(value_series, axis=1))
|
|
|
|
if not isinstance(result, pd.DataFrame):
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
"pandas.DataFrame, but is {}".format(type(result)))
|
|
if not len(result.columns) == len(return_type):
|
|
raise RuntimeError(
|
|
"Number of columns of the returned pandas.DataFrame "
|
|
"doesn't match specified schema. "
|
|
"Expected: {} Actual: {}".format(len(return_type), len(result.columns)))
|
|
return result
|
|
|
|
return lambda k, v: [(wrapped(k, v), to_arrow_type(return_type))]
|
|
|
|
|
|
def wrap_grouped_agg_pandas_udf(f, return_type):
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
def wrapped(*series):
|
|
import pandas as pd
|
|
result = f(*series)
|
|
return pd.Series([result])
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
def wrap_window_agg_pandas_udf(f, return_type, runner_conf, udf_index):
|
|
window_bound_types_str = runner_conf.get('pandas_window_bound_types')
|
|
window_bound_type = [t.strip().lower() for t in window_bound_types_str.split(',')][udf_index]
|
|
if window_bound_type == 'bounded':
|
|
return wrap_bounded_window_agg_pandas_udf(f, return_type)
|
|
elif window_bound_type == 'unbounded':
|
|
return wrap_unbounded_window_agg_pandas_udf(f, return_type)
|
|
else:
|
|
raise RuntimeError("Invalid window bound type: {} ".format(window_bound_type))
|
|
|
|
|
|
def wrap_unbounded_window_agg_pandas_udf(f, return_type):
|
|
# This is similar to grouped_agg_pandas_udf, the only difference
|
|
# is that window_agg_pandas_udf needs to repeat the return value
|
|
# to match window length, where grouped_agg_pandas_udf just returns
|
|
# the scalar value.
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
def wrapped(*series):
|
|
import pandas as pd
|
|
result = f(*series)
|
|
return pd.Series([result]).repeat(len(series[0]))
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
def wrap_bounded_window_agg_pandas_udf(f, return_type):
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
def wrapped(begin_index, end_index, *series):
|
|
import pandas as pd
|
|
result = []
|
|
|
|
# Index operation is faster on np.ndarray,
|
|
# So we turn the index series into np array
|
|
# here for performance
|
|
begin_array = begin_index.values
|
|
end_array = end_index.values
|
|
|
|
for i in range(len(begin_array)):
|
|
# Note: Create a slice from a series for each window is
|
|
# actually pretty expensive. However, there
|
|
# is no easy way to reduce cost here.
|
|
# Note: s.iloc[i : j] is about 30% faster than s[i: j], with
|
|
# the caveat that the created slices shares the same
|
|
# memory with s. Therefore, user are not allowed to
|
|
# change the value of input series inside the window
|
|
# function. It is rare that user needs to modify the
|
|
# input series in the window function, and therefore,
|
|
# it is be a reasonable restriction.
|
|
# Note: Calling reset_index on the slices will increase the cost
|
|
# of creating slices by about 100%. Therefore, for performance
|
|
# reasons we don't do it here.
|
|
series_slices = [s.iloc[begin_array[i]: end_array[i]] for s in series]
|
|
result.append(f(*series_slices))
|
|
return pd.Series(result)
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
def read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index):
|
|
num_arg = read_int(infile)
|
|
arg_offsets = [read_int(infile) for i in range(num_arg)]
|
|
chained_func = None
|
|
for i in range(read_int(infile)):
|
|
f, return_type = read_command(pickleSer, infile)
|
|
if chained_func is None:
|
|
chained_func = f
|
|
else:
|
|
chained_func = chain(chained_func, f)
|
|
|
|
if eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF:
|
|
func = chained_func
|
|
else:
|
|
# make sure StopIteration's raised in the user code are not ignored
|
|
# when they are processed in a for loop, raise them as RuntimeError's instead
|
|
func = fail_on_stopiteration(chained_func)
|
|
|
|
# the last returnType will be the return type of UDF
|
|
if eval_type == PythonEvalType.SQL_SCALAR_PANDAS_UDF:
|
|
return arg_offsets, wrap_scalar_pandas_udf(func, return_type)
|
|
elif eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF:
|
|
return arg_offsets, wrap_pandas_iter_udf(func, return_type)
|
|
elif eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF:
|
|
return arg_offsets, wrap_pandas_iter_udf(func, return_type)
|
|
elif eval_type == PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF:
|
|
argspec = _get_argspec(chained_func) # signature was lost when wrapping it
|
|
return arg_offsets, wrap_grouped_map_pandas_udf(func, return_type, argspec)
|
|
elif eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
|
argspec = _get_argspec(chained_func) # signature was lost when wrapping it
|
|
return arg_offsets, wrap_cogrouped_map_pandas_udf(func, return_type, argspec)
|
|
elif eval_type == PythonEvalType.SQL_GROUPED_AGG_PANDAS_UDF:
|
|
return arg_offsets, wrap_grouped_agg_pandas_udf(func, return_type)
|
|
elif eval_type == PythonEvalType.SQL_WINDOW_AGG_PANDAS_UDF:
|
|
return arg_offsets, wrap_window_agg_pandas_udf(func, return_type, runner_conf, udf_index)
|
|
elif eval_type == PythonEvalType.SQL_BATCHED_UDF:
|
|
return arg_offsets, wrap_udf(func, return_type)
|
|
else:
|
|
raise ValueError("Unknown eval type: {}".format(eval_type))
|
|
|
|
|
|
def read_udfs(pickleSer, infile, eval_type):
|
|
runner_conf = {}
|
|
|
|
if eval_type in (PythonEvalType.SQL_SCALAR_PANDAS_UDF,
|
|
PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF,
|
|
PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF,
|
|
PythonEvalType.SQL_MAP_PANDAS_ITER_UDF,
|
|
PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF,
|
|
PythonEvalType.SQL_GROUPED_AGG_PANDAS_UDF,
|
|
PythonEvalType.SQL_WINDOW_AGG_PANDAS_UDF):
|
|
|
|
# Load conf used for pandas_udf evaluation
|
|
num_conf = read_int(infile)
|
|
for i in range(num_conf):
|
|
k = utf8_deserializer.loads(infile)
|
|
v = utf8_deserializer.loads(infile)
|
|
runner_conf[k] = v
|
|
|
|
# NOTE: if timezone is set here, that implies respectSessionTimeZone is True
|
|
timezone = runner_conf.get("spark.sql.session.timeZone", None)
|
|
safecheck = runner_conf.get("spark.sql.execution.pandas.arrowSafeTypeConversion",
|
|
"false").lower() == 'true'
|
|
# Used by SQL_GROUPED_MAP_PANDAS_UDF and SQL_SCALAR_PANDAS_UDF when returning StructType
|
|
assign_cols_by_name = runner_conf.get(
|
|
"spark.sql.legacy.execution.pandas.groupedMap.assignColumnsByName", "true")\
|
|
.lower() == "true"
|
|
|
|
if eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
|
ser = CogroupUDFSerializer(timezone, safecheck, assign_cols_by_name)
|
|
else:
|
|
# Scalar Pandas UDF handles struct type arguments as pandas DataFrames instead of
|
|
# pandas Series. See SPARK-27240.
|
|
df_for_struct = (eval_type == PythonEvalType.SQL_SCALAR_PANDAS_UDF or
|
|
eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF or
|
|
eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF)
|
|
ser = ArrowStreamPandasUDFSerializer(timezone, safecheck, assign_cols_by_name,
|
|
df_for_struct)
|
|
else:
|
|
ser = BatchedSerializer(PickleSerializer(), 100)
|
|
|
|
num_udfs = read_int(infile)
|
|
|
|
is_scalar_iter = eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF
|
|
is_map_iter = eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF
|
|
|
|
if is_scalar_iter or is_map_iter:
|
|
if is_scalar_iter:
|
|
assert num_udfs == 1, "One SCALAR_ITER UDF expected here."
|
|
if is_map_iter:
|
|
assert num_udfs == 1, "One MAP_ITER UDF expected here."
|
|
|
|
arg_offsets, udf = read_single_udf(
|
|
pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
|
|
|
def func(_, iterator):
|
|
num_input_rows = [0]
|
|
|
|
def map_batch(batch):
|
|
udf_args = [batch[offset] for offset in arg_offsets]
|
|
num_input_rows[0] += len(udf_args[0])
|
|
if len(udf_args) == 1:
|
|
return udf_args[0]
|
|
else:
|
|
return tuple(udf_args)
|
|
|
|
iterator = map(map_batch, iterator)
|
|
result_iter = udf(iterator)
|
|
|
|
num_output_rows = 0
|
|
for result_batch, result_type in result_iter:
|
|
num_output_rows += len(result_batch)
|
|
assert is_map_iter or num_output_rows <= num_input_rows[0], \
|
|
"Pandas MAP_ITER UDF outputted more rows than input rows."
|
|
yield (result_batch, result_type)
|
|
|
|
if is_scalar_iter:
|
|
try:
|
|
next(iterator)
|
|
except StopIteration:
|
|
pass
|
|
else:
|
|
raise RuntimeError("SQL_SCALAR_PANDAS_ITER_UDF should exhaust the input "
|
|
"iterator.")
|
|
|
|
if is_scalar_iter and num_output_rows != num_input_rows[0]:
|
|
raise RuntimeError("The number of output rows of pandas iterator UDF should be "
|
|
"the same with input rows. The input rows number is %d but the "
|
|
"output rows number is %d." %
|
|
(num_input_rows[0], num_output_rows))
|
|
|
|
# profiling is not supported for UDF
|
|
return func, None, ser, ser
|
|
|
|
def extract_key_value_indexes(grouped_arg_offsets):
|
|
"""
|
|
Helper function to extract the key and value indexes from arg_offsets for the grouped and
|
|
cogrouped pandas udfs. See BasePandasGroupExec.resolveArgOffsets for equivalent scala code.
|
|
|
|
:param grouped_arg_offsets: List containing the key and value indexes of columns of the
|
|
DataFrames to be passed to the udf. It consists of n repeating groups where n is the
|
|
number of DataFrames. Each group has the following format:
|
|
group[0]: length of group
|
|
group[1]: length of key indexes
|
|
group[2.. group[1] +2]: key attributes
|
|
group[group[1] +3 group[0]]: value attributes
|
|
"""
|
|
parsed = []
|
|
idx = 0
|
|
while idx < len(grouped_arg_offsets):
|
|
offsets_len = grouped_arg_offsets[idx]
|
|
idx += 1
|
|
offsets = grouped_arg_offsets[idx: idx + offsets_len]
|
|
split_index = offsets[0] + 1
|
|
offset_keys = offsets[1: split_index]
|
|
offset_values = offsets[split_index:]
|
|
parsed.append([offset_keys, offset_values])
|
|
idx += offsets_len
|
|
return parsed
|
|
|
|
if eval_type == PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF:
|
|
# We assume there is only one UDF here because grouped map doesn't
|
|
# support combining multiple UDFs.
|
|
assert num_udfs == 1
|
|
|
|
# See FlatMapGroupsInPandasExec for how arg_offsets are used to
|
|
# distinguish between grouping attributes and data attributes
|
|
arg_offsets, f = read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
|
parsed_offsets = extract_key_value_indexes(arg_offsets)
|
|
|
|
# Create function like this:
|
|
# mapper a: f([a[0]], [a[0], a[1]])
|
|
def mapper(a):
|
|
keys = [a[o] for o in parsed_offsets[0][0]]
|
|
vals = [a[o] for o in parsed_offsets[0][1]]
|
|
return f(keys, vals)
|
|
elif eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
|
# We assume there is only one UDF here because cogrouped map doesn't
|
|
# support combining multiple UDFs.
|
|
assert num_udfs == 1
|
|
arg_offsets, f = read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
|
|
|
parsed_offsets = extract_key_value_indexes(arg_offsets)
|
|
|
|
def mapper(a):
|
|
df1_keys = [a[0][o] for o in parsed_offsets[0][0]]
|
|
df1_vals = [a[0][o] for o in parsed_offsets[0][1]]
|
|
df2_keys = [a[1][o] for o in parsed_offsets[1][0]]
|
|
df2_vals = [a[1][o] for o in parsed_offsets[1][1]]
|
|
return f(df1_keys, df1_vals, df2_keys, df2_vals)
|
|
else:
|
|
udfs = []
|
|
for i in range(num_udfs):
|
|
udfs.append(read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=i))
|
|
|
|
def mapper(a):
|
|
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
|
|
# In the special case of a single UDF this will return a single result rather
|
|
# than a tuple of results; this is the format that the JVM side expects.
|
|
if len(result) == 1:
|
|
return result[0]
|
|
else:
|
|
return result
|
|
|
|
func = lambda _, it: map(mapper, it)
|
|
|
|
# profiling is not supported for UDF
|
|
return func, None, ser, ser
|
|
|
|
|
|
def main(infile, outfile):
|
|
try:
|
|
boot_time = time.time()
|
|
split_index = read_int(infile)
|
|
if split_index == -1: # for unit tests
|
|
sys.exit(-1)
|
|
|
|
version = utf8_deserializer.loads(infile)
|
|
if version != "%d.%d" % sys.version_info[:2]:
|
|
raise Exception(("Python in worker has different version %s than that in " +
|
|
"driver %s, PySpark cannot run with different minor versions." +
|
|
"Please check environment variables PYSPARK_PYTHON and " +
|
|
"PYSPARK_DRIVER_PYTHON are correctly set.") %
|
|
("%d.%d" % sys.version_info[:2], version))
|
|
|
|
# read inputs only for a barrier task
|
|
isBarrier = read_bool(infile)
|
|
boundPort = read_int(infile)
|
|
secret = UTF8Deserializer().loads(infile)
|
|
|
|
# set up memory limits
|
|
memory_limit_mb = int(os.environ.get('PYSPARK_EXECUTOR_MEMORY_MB', "-1"))
|
|
if memory_limit_mb > 0 and has_resource_module:
|
|
total_memory = resource.RLIMIT_AS
|
|
try:
|
|
(soft_limit, hard_limit) = resource.getrlimit(total_memory)
|
|
msg = "Current mem limits: {0} of max {1}\n".format(soft_limit, hard_limit)
|
|
print(msg, file=sys.stderr)
|
|
|
|
# convert to bytes
|
|
new_limit = memory_limit_mb * 1024 * 1024
|
|
|
|
if soft_limit == resource.RLIM_INFINITY or new_limit < soft_limit:
|
|
msg = "Setting mem limits to {0} of max {1}\n".format(new_limit, new_limit)
|
|
print(msg, file=sys.stderr)
|
|
resource.setrlimit(total_memory, (new_limit, new_limit))
|
|
|
|
except (resource.error, OSError, ValueError) as e:
|
|
# not all systems support resource limits, so warn instead of failing
|
|
print("WARN: Failed to set memory limit: {0}\n".format(e), file=sys.stderr)
|
|
|
|
# initialize global state
|
|
taskContext = None
|
|
if isBarrier:
|
|
taskContext = BarrierTaskContext._getOrCreate()
|
|
BarrierTaskContext._initialize(boundPort, secret)
|
|
# Set the task context instance here, so we can get it by TaskContext.get for
|
|
# both TaskContext and BarrierTaskContext
|
|
TaskContext._setTaskContext(taskContext)
|
|
else:
|
|
taskContext = TaskContext._getOrCreate()
|
|
# read inputs for TaskContext info
|
|
taskContext._stageId = read_int(infile)
|
|
taskContext._partitionId = read_int(infile)
|
|
taskContext._attemptNumber = read_int(infile)
|
|
taskContext._taskAttemptId = read_long(infile)
|
|
taskContext._resources = {}
|
|
for r in range(read_int(infile)):
|
|
key = utf8_deserializer.loads(infile)
|
|
name = utf8_deserializer.loads(infile)
|
|
addresses = []
|
|
taskContext._resources = {}
|
|
for a in range(read_int(infile)):
|
|
addresses.append(utf8_deserializer.loads(infile))
|
|
taskContext._resources[key] = ResourceInformation(name, addresses)
|
|
|
|
taskContext._localProperties = dict()
|
|
for i in range(read_int(infile)):
|
|
k = utf8_deserializer.loads(infile)
|
|
v = utf8_deserializer.loads(infile)
|
|
taskContext._localProperties[k] = v
|
|
|
|
shuffle.MemoryBytesSpilled = 0
|
|
shuffle.DiskBytesSpilled = 0
|
|
_accumulatorRegistry.clear()
|
|
|
|
# fetch name of workdir
|
|
spark_files_dir = utf8_deserializer.loads(infile)
|
|
SparkFiles._root_directory = spark_files_dir
|
|
SparkFiles._is_running_on_worker = True
|
|
|
|
# fetch names of includes (*.zip and *.egg files) and construct PYTHONPATH
|
|
add_path(spark_files_dir) # *.py files that were added will be copied here
|
|
num_python_includes = read_int(infile)
|
|
for _ in range(num_python_includes):
|
|
filename = utf8_deserializer.loads(infile)
|
|
add_path(os.path.join(spark_files_dir, filename))
|
|
if sys.version > '3':
|
|
import importlib
|
|
importlib.invalidate_caches()
|
|
|
|
# fetch names and values of broadcast variables
|
|
needs_broadcast_decryption_server = read_bool(infile)
|
|
num_broadcast_variables = read_int(infile)
|
|
if needs_broadcast_decryption_server:
|
|
# read the decrypted data from a server in the jvm
|
|
port = read_int(infile)
|
|
auth_secret = utf8_deserializer.loads(infile)
|
|
(broadcast_sock_file, _) = local_connect_and_auth(port, auth_secret)
|
|
|
|
for _ in range(num_broadcast_variables):
|
|
bid = read_long(infile)
|
|
if bid >= 0:
|
|
if needs_broadcast_decryption_server:
|
|
read_bid = read_long(broadcast_sock_file)
|
|
assert(read_bid == bid)
|
|
_broadcastRegistry[bid] = \
|
|
Broadcast(sock_file=broadcast_sock_file)
|
|
else:
|
|
path = utf8_deserializer.loads(infile)
|
|
_broadcastRegistry[bid] = Broadcast(path=path)
|
|
|
|
else:
|
|
bid = - bid - 1
|
|
_broadcastRegistry.pop(bid)
|
|
|
|
if needs_broadcast_decryption_server:
|
|
broadcast_sock_file.write(b'1')
|
|
broadcast_sock_file.close()
|
|
|
|
_accumulatorRegistry.clear()
|
|
eval_type = read_int(infile)
|
|
if eval_type == PythonEvalType.NON_UDF:
|
|
func, profiler, deserializer, serializer = read_command(pickleSer, infile)
|
|
else:
|
|
func, profiler, deserializer, serializer = read_udfs(pickleSer, infile, eval_type)
|
|
|
|
init_time = time.time()
|
|
|
|
def process():
|
|
iterator = deserializer.load_stream(infile)
|
|
out_iter = func(split_index, iterator)
|
|
try:
|
|
serializer.dump_stream(out_iter, outfile)
|
|
finally:
|
|
if hasattr(out_iter, 'close'):
|
|
out_iter.close()
|
|
|
|
if profiler:
|
|
profiler.profile(process)
|
|
else:
|
|
process()
|
|
|
|
# Reset task context to None. This is a guard code to avoid residual context when worker
|
|
# reuse.
|
|
TaskContext._setTaskContext(None)
|
|
BarrierTaskContext._setTaskContext(None)
|
|
except Exception:
|
|
try:
|
|
exc_info = traceback.format_exc()
|
|
if isinstance(exc_info, bytes):
|
|
# exc_info may contains other encoding bytes, replace the invalid bytes and convert
|
|
# it back to utf-8 again
|
|
exc_info = exc_info.decode("utf-8", "replace").encode("utf-8")
|
|
else:
|
|
exc_info = exc_info.encode("utf-8")
|
|
write_int(SpecialLengths.PYTHON_EXCEPTION_THROWN, outfile)
|
|
write_with_length(exc_info, outfile)
|
|
except IOError:
|
|
# JVM close the socket
|
|
pass
|
|
except Exception:
|
|
# Write the error to stderr if it happened while serializing
|
|
print("PySpark worker failed with exception:", file=sys.stderr)
|
|
print(traceback.format_exc(), file=sys.stderr)
|
|
sys.exit(-1)
|
|
finish_time = time.time()
|
|
report_times(outfile, boot_time, init_time, finish_time)
|
|
write_long(shuffle.MemoryBytesSpilled, outfile)
|
|
write_long(shuffle.DiskBytesSpilled, outfile)
|
|
|
|
# Mark the beginning of the accumulators section of the output
|
|
write_int(SpecialLengths.END_OF_DATA_SECTION, outfile)
|
|
write_int(len(_accumulatorRegistry), outfile)
|
|
for (aid, accum) in _accumulatorRegistry.items():
|
|
pickleSer._write_with_length((aid, accum._value), outfile)
|
|
|
|
# check end of stream
|
|
if read_int(infile) == SpecialLengths.END_OF_STREAM:
|
|
write_int(SpecialLengths.END_OF_STREAM, outfile)
|
|
else:
|
|
# write a different value to tell JVM to not reuse this worker
|
|
write_int(SpecialLengths.END_OF_DATA_SECTION, outfile)
|
|
sys.exit(-1)
|
|
|
|
|
|
if __name__ == '__main__':
|
|
# Read information about how to connect back to the JVM from the environment.
|
|
java_port = int(os.environ["PYTHON_WORKER_FACTORY_PORT"])
|
|
auth_secret = os.environ["PYTHON_WORKER_FACTORY_SECRET"]
|
|
(sock_file, _) = local_connect_and_auth(java_port, auth_secret)
|
|
main(sock_file, sock_file)
|