2013-07-16 20:21:33 -04:00
|
|
|
#
|
|
|
|
# Licensed to the Apache Software Foundation (ASF) under one or more
|
|
|
|
# contributor license agreements. See the NOTICE file distributed with
|
|
|
|
# this work for additional information regarding copyright ownership.
|
|
|
|
# The ASF licenses this file to You under the Apache License, Version 2.0
|
|
|
|
# (the "License"); you may not use this file except in compliance with
|
|
|
|
# the License. You may obtain a copy of the License at
|
|
|
|
#
|
|
|
|
# http://www.apache.org/licenses/LICENSE-2.0
|
|
|
|
#
|
|
|
|
# Unless required by applicable law or agreed to in writing, software
|
|
|
|
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
|
|
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
|
|
# See the License for the specific language governing permissions and
|
|
|
|
# limitations under the License.
|
|
|
|
#
|
|
|
|
|
2012-08-10 04:10:02 -04:00
|
|
|
"""
|
|
|
|
Worker that receives input from Piped RDD.
|
|
|
|
"""
|
2013-02-01 03:25:19 -05:00
|
|
|
import os
|
2012-08-10 04:10:02 -04:00
|
|
|
import sys
|
2013-05-06 19:34:30 -04:00
|
|
|
import time
|
2021-01-17 19:32:55 -05:00
|
|
|
from inspect import currentframe, getframeinfo, getfullargspec
|
2020-07-13 22:22:44 -04:00
|
|
|
import importlib
|
2018-12-02 04:41:08 -05:00
|
|
|
# 'resource' is a Unix specific module.
|
|
|
|
has_resource_module = True
|
|
|
|
try:
|
|
|
|
import resource
|
|
|
|
except ImportError:
|
|
|
|
has_resource_module = False
|
2013-01-31 21:02:28 -05:00
|
|
|
import traceback
|
2021-01-17 19:32:55 -05:00
|
|
|
import warnings
|
2021-07-08 22:30:39 -04:00
|
|
|
import faulthandler
|
2014-09-14 01:31:21 -04:00
|
|
|
|
2013-01-20 04:57:44 -05:00
|
|
|
from pyspark.accumulators import _accumulatorRegistry
|
2012-08-25 16:59:01 -04:00
|
|
|
from pyspark.broadcast import Broadcast, _broadcastRegistry
|
2018-08-28 21:47:38 -04:00
|
|
|
from pyspark.java_gateway import local_connect_and_auth
|
2018-08-21 18:54:30 -04:00
|
|
|
from pyspark.taskcontext import BarrierTaskContext, TaskContext
|
2013-01-21 19:42:24 -05:00
|
|
|
from pyspark.files import SparkFiles
|
2020-05-19 20:09:37 -04:00
|
|
|
from pyspark.resource import ResourceInformation
|
2017-11-17 10:43:08 -05:00
|
|
|
from pyspark.rdd import PythonEvalType
|
2018-08-21 18:54:30 -04:00
|
|
|
from pyspark.serializers import write_with_length, write_int, read_long, read_bool, \
|
2017-11-17 10:43:08 -05:00
|
|
|
write_long, read_int, SpecialLengths, UTF8Deserializer, PickleSerializer, \
|
[SPARK-30434][PYTHON][SQL] Move pandas related functionalities into 'pandas' sub-package
### What changes were proposed in this pull request?
This PR proposes to move pandas related functionalities into pandas package. Namely:
```bash
pyspark/sql/pandas
├── __init__.py
├── conversion.py # Conversion between pandas <> PySpark DataFrames
├── functions.py # pandas_udf
├── group_ops.py # Grouped UDF / Cogrouped UDF + groupby.apply, groupby.cogroup.apply
├── map_ops.py # Map Iter UDF + mapInPandas
├── serializers.py # pandas <> PyArrow serializers
├── types.py # Type utils between pandas <> PyArrow
└── utils.py # Version requirement checks
```
In order to separately locate `groupby.apply`, `groupby.cogroup.apply`, `mapInPandas`, `toPandas`, and `createDataFrame(pdf)` under `pandas` sub-package, I had to use a mix-in approach which Scala side uses often by `trait`, and also pandas itself uses this approach (see `IndexOpsMixin` as an example) to group related functionalities. Currently, you can think it's like Scala's self typed trait. See the structure below:
```python
class PandasMapOpsMixin(object):
def mapInPandas(self, ...):
...
return ...
# other Pandas <> PySpark APIs
```
```python
class DataFrame(PandasMapOpsMixin):
# other DataFrame APIs equivalent to Scala side.
```
Yes, This is a big PR but they are mostly just moving around except one case `createDataFrame` which I had to split the methods.
### Why are the changes needed?
There are pandas functionalities here and there and I myself gets lost where it was. Also, when you have to make a change commonly for all of pandas related features, it's almost impossible now.
Also, after this change, `DataFrame` and `SparkSession` become more consistent with Scala side since pandas is specific to Python, and this change separates pandas-specific APIs away from `DataFrame` or `SparkSession`.
### Does this PR introduce any user-facing change?
No.
### How was this patch tested?
Existing tests should cover. Also, I manually built the PySpark API documentation and checked.
Closes #27109 from HyukjinKwon/pandas-refactoring.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2020-01-08 20:22:50 -05:00
|
|
|
BatchedSerializer
|
|
|
|
from pyspark.sql.pandas.serializers import ArrowStreamPandasUDFSerializer, CogroupUDFSerializer
|
|
|
|
from pyspark.sql.pandas.types import to_arrow_type
|
|
|
|
from pyspark.sql.types import StructType
|
2021-06-17 23:02:29 -04:00
|
|
|
from pyspark.util import fail_on_stopiteration, try_simplify_traceback # type: ignore
|
2014-09-14 01:31:21 -04:00
|
|
|
from pyspark import shuffle
|
2013-11-05 20:52:39 -05:00
|
|
|
|
|
|
|
pickleSer = PickleSerializer()
|
2014-01-28 22:50:26 -05:00
|
|
|
utf8_deserializer = UTF8Deserializer()
|
2012-08-25 19:46:07 -04:00
|
|
|
|
2012-08-10 04:10:02 -04:00
|
|
|
|
2013-05-06 19:34:30 -04:00
|
|
|
def report_times(outfile, boot, init, finish):
|
2013-11-03 00:13:18 -04:00
|
|
|
write_int(SpecialLengths.TIMING_DATA, outfile)
|
2015-04-16 19:20:57 -04:00
|
|
|
write_long(int(1000 * boot), outfile)
|
|
|
|
write_long(int(1000 * init), outfile)
|
|
|
|
write_long(int(1000 * finish), outfile)
|
2013-03-10 16:54:46 -04:00
|
|
|
|
|
|
|
|
2014-09-24 15:10:09 -04:00
|
|
|
def add_path(path):
|
2020-11-27 11:22:45 -05:00
|
|
|
# worker can be used, so do not add path multiple times
|
2014-09-24 15:10:09 -04:00
|
|
|
if path not in sys.path:
|
|
|
|
# overwrite system packages
|
|
|
|
sys.path.insert(1, path)
|
|
|
|
|
|
|
|
|
[SPARK-14215] [SQL] [PYSPARK] Support chained Python UDFs
## What changes were proposed in this pull request?
This PR brings the support for chained Python UDFs, for example
```sql
select udf1(udf2(a))
select udf1(udf2(a) + 3)
select udf1(udf2(a) + udf3(b))
```
Also directly chained unary Python UDFs are put in single batch of Python UDFs, others may require multiple batches.
For example,
```python
>>> sqlContext.sql("select double(double(1))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#10 AS double(double(1))#9]
: +- INPUT
+- !BatchPythonEvaluation double(double(1)), [pythonUDF#10]
+- Scan OneRowRelation[]
>>> sqlContext.sql("select double(double(1) + double(2))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#19 AS double((double(1) + double(2)))#16]
: +- INPUT
+- !BatchPythonEvaluation double((pythonUDF#17 + pythonUDF#18)), [pythonUDF#17,pythonUDF#18,pythonUDF#19]
+- !BatchPythonEvaluation double(2), [pythonUDF#17,pythonUDF#18]
+- !BatchPythonEvaluation double(1), [pythonUDF#17]
+- Scan OneRowRelation[]
```
TODO: will support multiple unrelated Python UDFs in one batch (another PR).
## How was this patch tested?
Added new unit tests for chained UDFs.
Author: Davies Liu <davies@databricks.com>
Closes #12014 from davies/py_udfs.
2016-03-29 18:06:29 -04:00
|
|
|
def read_command(serializer, file):
|
|
|
|
command = serializer._read_with_length(file)
|
|
|
|
if isinstance(command, Broadcast):
|
|
|
|
command = serializer.loads(command.value)
|
|
|
|
return command
|
|
|
|
|
|
|
|
|
2017-09-25 21:54:00 -04:00
|
|
|
def chain(f, g):
|
2017-09-22 04:17:41 -04:00
|
|
|
"""chain two functions together """
|
2017-09-25 21:54:00 -04:00
|
|
|
return lambda *a: g(f(*a))
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
|
|
|
|
|
|
|
|
def wrap_udf(f, return_type):
|
|
|
|
if return_type.needConversion():
|
|
|
|
toInternal = return_type.toInternal
|
|
|
|
return lambda *a: toInternal(f(*a))
|
|
|
|
else:
|
|
|
|
return lambda *a: f(*a)
|
|
|
|
|
|
|
|
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
def wrap_scalar_pandas_udf(f, return_type):
|
2017-10-20 15:44:30 -04:00
|
|
|
arrow_return_type = to_arrow_type(return_type)
|
2017-10-10 18:32:01 -04:00
|
|
|
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
def verify_result_type(result):
|
2017-10-20 15:44:30 -04:00
|
|
|
if not hasattr(result, "__len__"):
|
2019-03-07 11:52:24 -05:00
|
|
|
pd_type = "Pandas.DataFrame" if type(return_type) == StructType else "Pandas.Series"
|
2018-05-13 16:19:03 -04:00
|
|
|
raise TypeError("Return type of the user-defined function should be "
|
2019-03-07 11:52:24 -05:00
|
|
|
"{}, but is {}".format(pd_type, type(result)))
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
return result
|
|
|
|
|
|
|
|
def verify_result_length(result, length):
|
|
|
|
if len(result) != length:
|
2017-10-20 15:44:30 -04:00
|
|
|
raise RuntimeError("Result vector from pandas_udf was not the required length: "
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
"expected %d, got %d" % (length, len(result)))
|
2017-10-20 15:44:30 -04:00
|
|
|
return result
|
2017-10-10 18:32:01 -04:00
|
|
|
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
return lambda *a: (verify_result_length(
|
|
|
|
verify_result_type(f(*a)), len(a[0])), arrow_return_type)
|
|
|
|
|
|
|
|
|
|
|
|
def wrap_pandas_iter_udf(f, return_type):
|
|
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
|
|
|
|
def verify_result_type(result):
|
|
|
|
if not hasattr(result, "__len__"):
|
|
|
|
pd_type = "Pandas.DataFrame" if type(return_type) == StructType else "Pandas.Series"
|
|
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
|
|
"{}, but is {}".format(pd_type, type(result)))
|
|
|
|
return result
|
|
|
|
|
|
|
|
return lambda *iterator: map(lambda res: (res, arrow_return_type),
|
|
|
|
map(verify_result_type, f(*iterator)))
|
2017-09-22 04:17:41 -04:00
|
|
|
|
|
|
|
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
def wrap_cogrouped_map_pandas_udf(f, return_type, argspec):
|
|
|
|
|
|
|
|
def wrapped(left_key_series, left_value_series, right_key_series, right_value_series):
|
|
|
|
import pandas as pd
|
|
|
|
|
|
|
|
left_df = pd.concat(left_value_series, axis=1)
|
|
|
|
right_df = pd.concat(right_value_series, axis=1)
|
|
|
|
|
|
|
|
if len(argspec.args) == 2:
|
|
|
|
result = f(left_df, right_df)
|
|
|
|
elif len(argspec.args) == 3:
|
|
|
|
key_series = left_key_series if not left_df.empty else right_key_series
|
|
|
|
key = tuple(s[0] for s in key_series)
|
|
|
|
result = f(key, left_df, right_df)
|
|
|
|
if not isinstance(result, pd.DataFrame):
|
|
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
|
|
"pandas.DataFrame, but is {}".format(type(result)))
|
|
|
|
if not len(result.columns) == len(return_type):
|
|
|
|
raise RuntimeError(
|
|
|
|
"Number of columns of the returned pandas.DataFrame "
|
|
|
|
"doesn't match specified schema. "
|
|
|
|
"Expected: {} Actual: {}".format(len(return_type), len(result.columns)))
|
|
|
|
return result
|
|
|
|
|
|
|
|
return lambda kl, vl, kr, vr: [(wrapped(kl, vl, kr, vr), to_arrow_type(return_type))]
|
|
|
|
|
|
|
|
|
2019-03-21 04:44:51 -04:00
|
|
|
def wrap_grouped_map_pandas_udf(f, return_type, argspec):
|
2018-06-23 21:28:46 -04:00
|
|
|
|
2018-03-08 06:29:07 -05:00
|
|
|
def wrapped(key_series, value_series):
|
2017-11-17 10:43:08 -05:00
|
|
|
import pandas as pd
|
2018-03-08 06:29:07 -05:00
|
|
|
|
|
|
|
if len(argspec.args) == 1:
|
|
|
|
result = f(pd.concat(value_series, axis=1))
|
|
|
|
elif len(argspec.args) == 2:
|
|
|
|
key = tuple(s[0] for s in key_series)
|
|
|
|
result = f(key, pd.concat(value_series, axis=1))
|
2017-11-17 10:43:08 -05:00
|
|
|
|
|
|
|
if not isinstance(result, pd.DataFrame):
|
|
|
|
raise TypeError("Return type of the user-defined function should be "
|
|
|
|
"pandas.DataFrame, but is {}".format(type(result)))
|
|
|
|
if not len(result.columns) == len(return_type):
|
|
|
|
raise RuntimeError(
|
|
|
|
"Number of columns of the returned pandas.DataFrame "
|
|
|
|
"doesn't match specified schema. "
|
|
|
|
"Expected: {} Actual: {}".format(len(return_type), len(result.columns)))
|
2019-03-21 04:44:51 -04:00
|
|
|
return result
|
2018-06-23 21:28:46 -04:00
|
|
|
|
2019-03-21 04:44:51 -04:00
|
|
|
return lambda k, v: [(wrapped(k, v), to_arrow_type(return_type))]
|
2017-11-17 10:43:08 -05:00
|
|
|
|
|
|
|
|
2018-01-30 07:55:55 -05:00
|
|
|
def wrap_grouped_agg_pandas_udf(f, return_type):
|
2018-01-23 00:11:30 -05:00
|
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
|
|
|
|
def wrapped(*series):
|
|
|
|
import pandas as pd
|
|
|
|
result = f(*series)
|
[SPARK-23352][PYTHON] Explicitly specify supported types in Pandas UDFs
## What changes were proposed in this pull request?
This PR targets to explicitly specify supported types in Pandas UDFs.
The main change here is to add a deduplicated and explicit type checking in `returnType` ahead with documenting this; however, it happened to fix multiple things.
1. Currently, we don't support `BinaryType` in Pandas UDFs, for example, see:
```python
from pyspark.sql.functions import pandas_udf
pudf = pandas_udf(lambda x: x, "binary")
df = spark.createDataFrame([[bytearray(1)]])
df.select(pudf("_1")).show()
```
```
...
TypeError: Unsupported type in conversion to Arrow: BinaryType
```
We can document this behaviour for its guide.
2. Also, the grouped aggregate Pandas UDF fails fast on `ArrayType` but seems we can support this case.
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
foo = pandas_udf(lambda v: v.mean(), 'array<double>', PandasUDFType.GROUPED_AGG)
df = spark.range(100).selectExpr("id", "array(id) as value")
df.groupBy("id").agg(foo("value")).show()
```
```
...
NotImplementedError: ArrayType, StructType and MapType are not supported with PandasUDFType.GROUPED_AGG
```
3. Since we can check the return type ahead, we can fail fast before actual execution.
```python
# we can fail fast at this stage because we know the schema ahead
pandas_udf(lambda x: x, BinaryType())
```
## How was this patch tested?
Manually tested and unit tests for `BinaryType` and `ArrayType(...)` were added.
Author: hyukjinkwon <gurwls223@gmail.com>
Closes #20531 from HyukjinKwon/pudf-cleanup.
2018-02-12 06:49:36 -05:00
|
|
|
return pd.Series([result])
|
2018-01-23 00:11:30 -05:00
|
|
|
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
|
|
|
[SPARK-24561][SQL][PYTHON] User-defined window aggregation functions with Pandas UDF (bounded window)
## What changes were proposed in this pull request?
This PR implements a new feature - window aggregation Pandas UDF for bounded window.
#### Doc:
https://docs.google.com/document/d/14EjeY5z4-NC27-SmIP9CsMPCANeTcvxN44a7SIJtZPc/edit#heading=h.c87w44wcj3wj
#### Example:
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.window import Window
df = spark.range(0, 10, 2).toDF('v')
w1 = Window.partitionBy().orderBy('v').rangeBetween(-2, 4)
w2 = Window.partitionBy().orderBy('v').rowsBetween(-2, 2)
pandas_udf('double', PandasUDFType.GROUPED_AGG)
def avg(v):
return v.mean()
df.withColumn('v_mean', avg(df['v']).over(w1)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 1.0|
# | 2| 2.0|
# | 4| 4.0|
# | 6| 6.0|
# | 8| 7.0|
# +---+------+
df.withColumn('v_mean', avg(df['v']).over(w2)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 2.0|
# | 2| 3.0|
# | 4| 4.0|
# | 6| 5.0|
# | 8| 6.0|
# +---+------+
```
#### High level changes:
This PR modifies the existing WindowInPandasExec physical node to deal with unbounded (growing, shrinking and sliding) windows.
* `WindowInPandasExec` now share the same base class as `WindowExec` and share utility functions. See `WindowExecBase`
* `WindowFunctionFrame` now has two new functions `currentLowerBound` and `currentUpperBound` - to return the lower and upper window bound for the current output row. It is also modified to allow `AggregateProcessor` == null. Null aggregator processor is used for `WindowInPandasExec` where we don't have an aggregator and only uses lower and upper bound functions from `WindowFunctionFrame`
* The biggest change is in `WindowInPandasExec`, where it is modified to take `currentLowerBound` and `currentUpperBound` and write those values together with the input data to the python process for rolling window aggregation. See `WindowInPandasExec` for more details.
#### Discussion
In benchmarking, I found numpy variant of the rolling window UDF is much faster than the pandas version:
Spark SQL window function: 20s
Pandas variant: ~80s
Numpy variant: 10s
Numpy variant with numba: 4s
Allowing numpy variant of the vectorized UDFs is something I want to discuss because of the performance improvement, but doesn't have to be in this PR.
## How was this patch tested?
New tests
Closes #22305 from icexelloss/SPARK-24561-bounded-window-udf.
Authored-by: Li Jin <ice.xelloss@gmail.com>
Signed-off-by: Hyukjin Kwon <gurwls223@apache.org>
2018-12-17 20:15:21 -05:00
|
|
|
def wrap_window_agg_pandas_udf(f, return_type, runner_conf, udf_index):
|
|
|
|
window_bound_types_str = runner_conf.get('pandas_window_bound_types')
|
|
|
|
window_bound_type = [t.strip().lower() for t in window_bound_types_str.split(',')][udf_index]
|
|
|
|
if window_bound_type == 'bounded':
|
|
|
|
return wrap_bounded_window_agg_pandas_udf(f, return_type)
|
|
|
|
elif window_bound_type == 'unbounded':
|
|
|
|
return wrap_unbounded_window_agg_pandas_udf(f, return_type)
|
|
|
|
else:
|
|
|
|
raise RuntimeError("Invalid window bound type: {} ".format(window_bound_type))
|
|
|
|
|
|
|
|
|
|
|
|
def wrap_unbounded_window_agg_pandas_udf(f, return_type):
|
[SPARK-22239][SQL][PYTHON] Enable grouped aggregate pandas UDFs as window functions with unbounded window frames
## What changes were proposed in this pull request?
This PR enables using a grouped aggregate pandas UDFs as window functions. The semantics is the same as using SQL aggregation function as window functions.
```
>>> from pyspark.sql.functions import pandas_udf, PandasUDFType
>>> from pyspark.sql import Window
>>> df = spark.createDataFrame(
... [(1, 1.0), (1, 2.0), (2, 3.0), (2, 5.0), (2, 10.0)],
... ("id", "v"))
>>> pandas_udf("double", PandasUDFType.GROUPED_AGG)
... def mean_udf(v):
... return v.mean()
>>> w = Window.partitionBy('id')
>>> df.withColumn('mean_v', mean_udf(df['v']).over(w)).show()
+---+----+------+
| id| v|mean_v|
+---+----+------+
| 1| 1.0| 1.5|
| 1| 2.0| 1.5|
| 2| 3.0| 6.0|
| 2| 5.0| 6.0|
| 2|10.0| 6.0|
+---+----+------+
```
The scope of this PR is somewhat limited in terms of:
(1) Only supports unbounded window, which acts essentially as group by.
(2) Only supports aggregation functions, not "transform" like window functions (n -> n mapping)
Both of these are left as future work. Especially, (1) needs careful thinking w.r.t. how to pass rolling window data to python efficiently. (2) is a bit easier but does require more changes therefore I think it's better to leave it as a separate PR.
## How was this patch tested?
WindowPandasUDFTests
Author: Li Jin <ice.xelloss@gmail.com>
Closes #21082 from icexelloss/SPARK-22239-window-udf.
2018-06-12 21:10:52 -04:00
|
|
|
# This is similar to grouped_agg_pandas_udf, the only difference
|
|
|
|
# is that window_agg_pandas_udf needs to repeat the return value
|
|
|
|
# to match window length, where grouped_agg_pandas_udf just returns
|
|
|
|
# the scalar value.
|
|
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
|
|
|
|
def wrapped(*series):
|
|
|
|
import pandas as pd
|
|
|
|
result = f(*series)
|
|
|
|
return pd.Series([result]).repeat(len(series[0]))
|
|
|
|
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
|
|
|
[SPARK-24561][SQL][PYTHON] User-defined window aggregation functions with Pandas UDF (bounded window)
## What changes were proposed in this pull request?
This PR implements a new feature - window aggregation Pandas UDF for bounded window.
#### Doc:
https://docs.google.com/document/d/14EjeY5z4-NC27-SmIP9CsMPCANeTcvxN44a7SIJtZPc/edit#heading=h.c87w44wcj3wj
#### Example:
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.window import Window
df = spark.range(0, 10, 2).toDF('v')
w1 = Window.partitionBy().orderBy('v').rangeBetween(-2, 4)
w2 = Window.partitionBy().orderBy('v').rowsBetween(-2, 2)
pandas_udf('double', PandasUDFType.GROUPED_AGG)
def avg(v):
return v.mean()
df.withColumn('v_mean', avg(df['v']).over(w1)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 1.0|
# | 2| 2.0|
# | 4| 4.0|
# | 6| 6.0|
# | 8| 7.0|
# +---+------+
df.withColumn('v_mean', avg(df['v']).over(w2)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 2.0|
# | 2| 3.0|
# | 4| 4.0|
# | 6| 5.0|
# | 8| 6.0|
# +---+------+
```
#### High level changes:
This PR modifies the existing WindowInPandasExec physical node to deal with unbounded (growing, shrinking and sliding) windows.
* `WindowInPandasExec` now share the same base class as `WindowExec` and share utility functions. See `WindowExecBase`
* `WindowFunctionFrame` now has two new functions `currentLowerBound` and `currentUpperBound` - to return the lower and upper window bound for the current output row. It is also modified to allow `AggregateProcessor` == null. Null aggregator processor is used for `WindowInPandasExec` where we don't have an aggregator and only uses lower and upper bound functions from `WindowFunctionFrame`
* The biggest change is in `WindowInPandasExec`, where it is modified to take `currentLowerBound` and `currentUpperBound` and write those values together with the input data to the python process for rolling window aggregation. See `WindowInPandasExec` for more details.
#### Discussion
In benchmarking, I found numpy variant of the rolling window UDF is much faster than the pandas version:
Spark SQL window function: 20s
Pandas variant: ~80s
Numpy variant: 10s
Numpy variant with numba: 4s
Allowing numpy variant of the vectorized UDFs is something I want to discuss because of the performance improvement, but doesn't have to be in this PR.
## How was this patch tested?
New tests
Closes #22305 from icexelloss/SPARK-24561-bounded-window-udf.
Authored-by: Li Jin <ice.xelloss@gmail.com>
Signed-off-by: Hyukjin Kwon <gurwls223@apache.org>
2018-12-17 20:15:21 -05:00
|
|
|
def wrap_bounded_window_agg_pandas_udf(f, return_type):
|
|
|
|
arrow_return_type = to_arrow_type(return_type)
|
|
|
|
|
|
|
|
def wrapped(begin_index, end_index, *series):
|
|
|
|
import pandas as pd
|
|
|
|
result = []
|
|
|
|
|
|
|
|
# Index operation is faster on np.ndarray,
|
|
|
|
# So we turn the index series into np array
|
|
|
|
# here for performance
|
|
|
|
begin_array = begin_index.values
|
|
|
|
end_array = end_index.values
|
|
|
|
|
|
|
|
for i in range(len(begin_array)):
|
|
|
|
# Note: Create a slice from a series for each window is
|
|
|
|
# actually pretty expensive. However, there
|
|
|
|
# is no easy way to reduce cost here.
|
|
|
|
# Note: s.iloc[i : j] is about 30% faster than s[i: j], with
|
|
|
|
# the caveat that the created slices shares the same
|
|
|
|
# memory with s. Therefore, user are not allowed to
|
|
|
|
# change the value of input series inside the window
|
|
|
|
# function. It is rare that user needs to modify the
|
|
|
|
# input series in the window function, and therefore,
|
|
|
|
# it is be a reasonable restriction.
|
|
|
|
# Note: Calling reset_index on the slices will increase the cost
|
|
|
|
# of creating slices by about 100%. Therefore, for performance
|
|
|
|
# reasons we don't do it here.
|
|
|
|
series_slices = [s.iloc[begin_array[i]: end_array[i]] for s in series]
|
|
|
|
result.append(f(*series_slices))
|
|
|
|
return pd.Series(result)
|
|
|
|
|
|
|
|
return lambda *a: (wrapped(*a), arrow_return_type)
|
|
|
|
|
|
|
|
|
|
|
|
def read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index):
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
num_arg = read_int(infile)
|
|
|
|
arg_offsets = [read_int(infile) for i in range(num_arg)]
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
chained_func = None
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
for i in range(read_int(infile)):
|
|
|
|
f, return_type = read_command(pickleSer, infile)
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
if chained_func is None:
|
|
|
|
chained_func = f
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
else:
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
chained_func = chain(chained_func, f)
|
2017-11-17 10:43:08 -05:00
|
|
|
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
if eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF:
|
|
|
|
func = chained_func
|
|
|
|
else:
|
|
|
|
# make sure StopIteration's raised in the user code are not ignored
|
|
|
|
# when they are processed in a for loop, raise them as RuntimeError's instead
|
|
|
|
func = fail_on_stopiteration(chained_func)
|
[SPARK-23754][PYTHON][FOLLOWUP] Move UDF stop iteration wrapping from driver to executor
## What changes were proposed in this pull request?
SPARK-23754 was fixed in #21383 by changing the UDF code to wrap the user function, but this required a hack to save its argspec. This PR reverts this change and fixes the `StopIteration` bug in the worker
## How does this work?
The root of the problem is that when an user-supplied function raises a `StopIteration`, pyspark might stop processing data, if this function is used in a for-loop. The solution is to catch `StopIteration`s exceptions and re-raise them as `RuntimeError`s, so that the execution fails and the error is reported to the user. This is done using the `fail_on_stopiteration` wrapper, in different ways depending on where the function is used:
- In RDDs, the user function is wrapped in the driver, because this function is also called in the driver itself.
- In SQL UDFs, the function is wrapped in the worker, since all processing happens there. Moreover, the worker needs the signature of the user function, which is lost when wrapping it, but passing this signature to the worker requires a not so nice hack.
## How was this patch tested?
Same tests, plus tests for pandas UDFs
Author: edorigatti <emilio.dorigatti@gmail.com>
Closes #21467 from e-dorigatti/fix_udf_hack.
2018-06-10 22:15:42 -04:00
|
|
|
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
# the last returnType will be the return type of UDF
|
2018-01-30 07:55:55 -05:00
|
|
|
if eval_type == PythonEvalType.SQL_SCALAR_PANDAS_UDF:
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
return arg_offsets, wrap_scalar_pandas_udf(func, return_type)
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
elif eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF:
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
return arg_offsets, wrap_pandas_iter_udf(func, return_type)
|
|
|
|
elif eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF:
|
|
|
|
return arg_offsets, wrap_pandas_iter_udf(func, return_type)
|
2018-01-30 07:55:55 -05:00
|
|
|
elif eval_type == PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF:
|
2020-07-13 22:22:44 -04:00
|
|
|
argspec = getfullargspec(chained_func) # signature was lost when wrapping it
|
2019-03-21 04:44:51 -04:00
|
|
|
return arg_offsets, wrap_grouped_map_pandas_udf(func, return_type, argspec)
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
elif eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
2020-07-13 22:22:44 -04:00
|
|
|
argspec = getfullargspec(chained_func) # signature was lost when wrapping it
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
return arg_offsets, wrap_cogrouped_map_pandas_udf(func, return_type, argspec)
|
2018-01-30 07:55:55 -05:00
|
|
|
elif eval_type == PythonEvalType.SQL_GROUPED_AGG_PANDAS_UDF:
|
[SPARK-23754][PYTHON][FOLLOWUP] Move UDF stop iteration wrapping from driver to executor
## What changes were proposed in this pull request?
SPARK-23754 was fixed in #21383 by changing the UDF code to wrap the user function, but this required a hack to save its argspec. This PR reverts this change and fixes the `StopIteration` bug in the worker
## How does this work?
The root of the problem is that when an user-supplied function raises a `StopIteration`, pyspark might stop processing data, if this function is used in a for-loop. The solution is to catch `StopIteration`s exceptions and re-raise them as `RuntimeError`s, so that the execution fails and the error is reported to the user. This is done using the `fail_on_stopiteration` wrapper, in different ways depending on where the function is used:
- In RDDs, the user function is wrapped in the driver, because this function is also called in the driver itself.
- In SQL UDFs, the function is wrapped in the worker, since all processing happens there. Moreover, the worker needs the signature of the user function, which is lost when wrapping it, but passing this signature to the worker requires a not so nice hack.
## How was this patch tested?
Same tests, plus tests for pandas UDFs
Author: edorigatti <emilio.dorigatti@gmail.com>
Closes #21467 from e-dorigatti/fix_udf_hack.
2018-06-10 22:15:42 -04:00
|
|
|
return arg_offsets, wrap_grouped_agg_pandas_udf(func, return_type)
|
[SPARK-22239][SQL][PYTHON] Enable grouped aggregate pandas UDFs as window functions with unbounded window frames
## What changes were proposed in this pull request?
This PR enables using a grouped aggregate pandas UDFs as window functions. The semantics is the same as using SQL aggregation function as window functions.
```
>>> from pyspark.sql.functions import pandas_udf, PandasUDFType
>>> from pyspark.sql import Window
>>> df = spark.createDataFrame(
... [(1, 1.0), (1, 2.0), (2, 3.0), (2, 5.0), (2, 10.0)],
... ("id", "v"))
>>> pandas_udf("double", PandasUDFType.GROUPED_AGG)
... def mean_udf(v):
... return v.mean()
>>> w = Window.partitionBy('id')
>>> df.withColumn('mean_v', mean_udf(df['v']).over(w)).show()
+---+----+------+
| id| v|mean_v|
+---+----+------+
| 1| 1.0| 1.5|
| 1| 2.0| 1.5|
| 2| 3.0| 6.0|
| 2| 5.0| 6.0|
| 2|10.0| 6.0|
+---+----+------+
```
The scope of this PR is somewhat limited in terms of:
(1) Only supports unbounded window, which acts essentially as group by.
(2) Only supports aggregation functions, not "transform" like window functions (n -> n mapping)
Both of these are left as future work. Especially, (1) needs careful thinking w.r.t. how to pass rolling window data to python efficiently. (2) is a bit easier but does require more changes therefore I think it's better to leave it as a separate PR.
## How was this patch tested?
WindowPandasUDFTests
Author: Li Jin <ice.xelloss@gmail.com>
Closes #21082 from icexelloss/SPARK-22239-window-udf.
2018-06-12 21:10:52 -04:00
|
|
|
elif eval_type == PythonEvalType.SQL_WINDOW_AGG_PANDAS_UDF:
|
[SPARK-24561][SQL][PYTHON] User-defined window aggregation functions with Pandas UDF (bounded window)
## What changes were proposed in this pull request?
This PR implements a new feature - window aggregation Pandas UDF for bounded window.
#### Doc:
https://docs.google.com/document/d/14EjeY5z4-NC27-SmIP9CsMPCANeTcvxN44a7SIJtZPc/edit#heading=h.c87w44wcj3wj
#### Example:
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.window import Window
df = spark.range(0, 10, 2).toDF('v')
w1 = Window.partitionBy().orderBy('v').rangeBetween(-2, 4)
w2 = Window.partitionBy().orderBy('v').rowsBetween(-2, 2)
pandas_udf('double', PandasUDFType.GROUPED_AGG)
def avg(v):
return v.mean()
df.withColumn('v_mean', avg(df['v']).over(w1)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 1.0|
# | 2| 2.0|
# | 4| 4.0|
# | 6| 6.0|
# | 8| 7.0|
# +---+------+
df.withColumn('v_mean', avg(df['v']).over(w2)).show()
# +---+------+
# | v|v_mean|
# +---+------+
# | 0| 2.0|
# | 2| 3.0|
# | 4| 4.0|
# | 6| 5.0|
# | 8| 6.0|
# +---+------+
```
#### High level changes:
This PR modifies the existing WindowInPandasExec physical node to deal with unbounded (growing, shrinking and sliding) windows.
* `WindowInPandasExec` now share the same base class as `WindowExec` and share utility functions. See `WindowExecBase`
* `WindowFunctionFrame` now has two new functions `currentLowerBound` and `currentUpperBound` - to return the lower and upper window bound for the current output row. It is also modified to allow `AggregateProcessor` == null. Null aggregator processor is used for `WindowInPandasExec` where we don't have an aggregator and only uses lower and upper bound functions from `WindowFunctionFrame`
* The biggest change is in `WindowInPandasExec`, where it is modified to take `currentLowerBound` and `currentUpperBound` and write those values together with the input data to the python process for rolling window aggregation. See `WindowInPandasExec` for more details.
#### Discussion
In benchmarking, I found numpy variant of the rolling window UDF is much faster than the pandas version:
Spark SQL window function: 20s
Pandas variant: ~80s
Numpy variant: 10s
Numpy variant with numba: 4s
Allowing numpy variant of the vectorized UDFs is something I want to discuss because of the performance improvement, but doesn't have to be in this PR.
## How was this patch tested?
New tests
Closes #22305 from icexelloss/SPARK-24561-bounded-window-udf.
Authored-by: Li Jin <ice.xelloss@gmail.com>
Signed-off-by: Hyukjin Kwon <gurwls223@apache.org>
2018-12-17 20:15:21 -05:00
|
|
|
return arg_offsets, wrap_window_agg_pandas_udf(func, return_type, runner_conf, udf_index)
|
2018-01-23 00:11:30 -05:00
|
|
|
elif eval_type == PythonEvalType.SQL_BATCHED_UDF:
|
[SPARK-23754][PYTHON][FOLLOWUP] Move UDF stop iteration wrapping from driver to executor
## What changes were proposed in this pull request?
SPARK-23754 was fixed in #21383 by changing the UDF code to wrap the user function, but this required a hack to save its argspec. This PR reverts this change and fixes the `StopIteration` bug in the worker
## How does this work?
The root of the problem is that when an user-supplied function raises a `StopIteration`, pyspark might stop processing data, if this function is used in a for-loop. The solution is to catch `StopIteration`s exceptions and re-raise them as `RuntimeError`s, so that the execution fails and the error is reported to the user. This is done using the `fail_on_stopiteration` wrapper, in different ways depending on where the function is used:
- In RDDs, the user function is wrapped in the driver, because this function is also called in the driver itself.
- In SQL UDFs, the function is wrapped in the worker, since all processing happens there. Moreover, the worker needs the signature of the user function, which is lost when wrapping it, but passing this signature to the worker requires a not so nice hack.
## How was this patch tested?
Same tests, plus tests for pandas UDFs
Author: edorigatti <emilio.dorigatti@gmail.com>
Closes #21467 from e-dorigatti/fix_udf_hack.
2018-06-10 22:15:42 -04:00
|
|
|
return arg_offsets, wrap_udf(func, return_type)
|
2018-01-23 00:11:30 -05:00
|
|
|
else:
|
|
|
|
raise ValueError("Unknown eval type: {}".format(eval_type))
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
|
|
|
|
|
2017-09-22 04:17:41 -04:00
|
|
|
def read_udfs(pickleSer, infile, eval_type):
|
2018-06-23 21:28:46 -04:00
|
|
|
runner_conf = {}
|
|
|
|
|
|
|
|
if eval_type in (PythonEvalType.SQL_SCALAR_PANDAS_UDF,
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF,
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF,
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
PythonEvalType.SQL_MAP_PANDAS_ITER_UDF,
|
2018-06-23 21:28:46 -04:00
|
|
|
PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF,
|
|
|
|
PythonEvalType.SQL_GROUPED_AGG_PANDAS_UDF,
|
|
|
|
PythonEvalType.SQL_WINDOW_AGG_PANDAS_UDF):
|
|
|
|
|
|
|
|
# Load conf used for pandas_udf evaluation
|
|
|
|
num_conf = read_int(infile)
|
|
|
|
for i in range(num_conf):
|
|
|
|
k = utf8_deserializer.loads(infile)
|
|
|
|
v = utf8_deserializer.loads(infile)
|
|
|
|
runner_conf[k] = v
|
|
|
|
|
|
|
|
# NOTE: if timezone is set here, that implies respectSessionTimeZone is True
|
|
|
|
timezone = runner_conf.get("spark.sql.session.timeZone", None)
|
2020-02-18 07:39:50 -05:00
|
|
|
safecheck = runner_conf.get("spark.sql.execution.pandas.convertToArrowArraySafely",
|
2019-01-22 01:54:41 -05:00
|
|
|
"false").lower() == 'true'
|
2019-03-21 04:44:51 -04:00
|
|
|
# Used by SQL_GROUPED_MAP_PANDAS_UDF and SQL_SCALAR_PANDAS_UDF when returning StructType
|
2019-03-07 11:52:24 -05:00
|
|
|
assign_cols_by_name = runner_conf.get(
|
|
|
|
"spark.sql.legacy.execution.pandas.groupedMap.assignColumnsByName", "true")\
|
|
|
|
.lower() == "true"
|
|
|
|
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
if eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
|
|
|
ser = CogroupUDFSerializer(timezone, safecheck, assign_cols_by_name)
|
|
|
|
else:
|
|
|
|
# Scalar Pandas UDF handles struct type arguments as pandas DataFrames instead of
|
|
|
|
# pandas Series. See SPARK-27240.
|
|
|
|
df_for_struct = (eval_type == PythonEvalType.SQL_SCALAR_PANDAS_UDF or
|
|
|
|
eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF or
|
|
|
|
eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF)
|
|
|
|
ser = ArrowStreamPandasUDFSerializer(timezone, safecheck, assign_cols_by_name,
|
|
|
|
df_for_struct)
|
2018-06-23 21:28:46 -04:00
|
|
|
else:
|
|
|
|
ser = BatchedSerializer(PickleSerializer(), 100)
|
|
|
|
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
num_udfs = read_int(infile)
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
is_scalar_iter = eval_type == PythonEvalType.SQL_SCALAR_PANDAS_ITER_UDF
|
|
|
|
is_map_iter = eval_type == PythonEvalType.SQL_MAP_PANDAS_ITER_UDF
|
|
|
|
|
|
|
|
if is_scalar_iter or is_map_iter:
|
2019-07-04 20:22:41 -04:00
|
|
|
if is_scalar_iter:
|
|
|
|
assert num_udfs == 1, "One SCALAR_ITER UDF expected here."
|
|
|
|
if is_map_iter:
|
|
|
|
assert num_udfs == 1, "One MAP_ITER UDF expected here."
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
|
|
|
|
arg_offsets, udf = read_single_udf(
|
|
|
|
pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
|
|
|
|
|
|
|
def func(_, iterator):
|
2020-07-13 22:22:44 -04:00
|
|
|
num_input_rows = 0
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
|
|
|
|
def map_batch(batch):
|
2020-07-13 22:22:44 -04:00
|
|
|
nonlocal num_input_rows
|
|
|
|
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
udf_args = [batch[offset] for offset in arg_offsets]
|
2020-07-13 22:22:44 -04:00
|
|
|
num_input_rows += len(udf_args[0])
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
if len(udf_args) == 1:
|
|
|
|
return udf_args[0]
|
|
|
|
else:
|
|
|
|
return tuple(udf_args)
|
|
|
|
|
|
|
|
iterator = map(map_batch, iterator)
|
|
|
|
result_iter = udf(iterator)
|
|
|
|
|
|
|
|
num_output_rows = 0
|
|
|
|
for result_batch, result_type in result_iter:
|
|
|
|
num_output_rows += len(result_batch)
|
2020-04-09 03:46:27 -04:00
|
|
|
# This assert is for Scalar Iterator UDF to fail fast.
|
|
|
|
# The length of the entire input can only be explicitly known
|
|
|
|
# by consuming the input iterator in user side. Therefore,
|
|
|
|
# it's very unlikely the output length is higher than
|
|
|
|
# input length.
|
2020-07-13 22:22:44 -04:00
|
|
|
assert is_map_iter or num_output_rows <= num_input_rows, \
|
2020-04-09 00:14:41 -04:00
|
|
|
"Pandas SCALAR_ITER UDF outputted more rows than input rows."
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
yield (result_batch, result_type)
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
|
|
|
|
if is_scalar_iter:
|
|
|
|
try:
|
|
|
|
next(iterator)
|
|
|
|
except StopIteration:
|
|
|
|
pass
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
else:
|
2020-04-09 00:14:41 -04:00
|
|
|
raise RuntimeError("pandas iterator UDF should exhaust the input "
|
[SPARK-28198][PYTHON] Add mapPartitionsInPandas to allow an iterator of DataFrames
## What changes were proposed in this pull request?
This PR proposes to add `mapPartitionsInPandas` API to DataFrame by using existing `SCALAR_ITER` as below:
1. Filtering via setting the column
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
df = spark.createDataFrame([(1, 21), (2, 30)], ("id", "age"))
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf[pdf.id == 1]
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+---+
| id|age|
+---+---+
| 1| 21|
+---+---+
```
2. `DataFrame.loc`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame([['aa'], ['bb'], ['cc'], ['aa'], ['aa'], ['aa']], ["value"])
pandas_udf(df.schema, PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
yield pdf.loc[pdf.value.str.contains('^a'), :]
df.mapPartitionsInPandas(filter_func).show()
```
```
+-----+
|value|
+-----+
| aa|
| aa|
| aa|
| aa|
+-----+
```
3. `pandas.melt`
```python
from pyspark.sql.functions import pandas_udf, PandasUDFType
import pandas as pd
df = spark.createDataFrame(
pd.DataFrame({'A': {0: 'a', 1: 'b', 2: 'c'},
'B': {0: 1, 1: 3, 2: 5},
'C': {0: 2, 1: 4, 2: 6}}))
pandas_udf("A string, variable string, value long", PandasUDFType.SCALAR_ITER)
def filter_func(iterator):
for pdf in iterator:
import pandas as pd
yield pd.melt(pdf, id_vars=['A'], value_vars=['B', 'C'])
df.mapPartitionsInPandas(filter_func).show()
```
```
+---+--------+-----+
| A|variable|value|
+---+--------+-----+
| a| B| 1|
| a| C| 2|
| b| B| 3|
| b| C| 4|
| c| B| 5|
| c| C| 6|
+---+--------+-----+
```
The current limitation of `SCALAR_ITER` is that it doesn't allow different length of result, which is pretty critical in practice - for instance, we cannot simply filter by using Pandas APIs but we merely just map N to N. This PR allows map N to M like flatMap.
This API mimics the way of `mapPartitions` but keeps API shape of `SCALAR_ITER` by allowing different results.
### How does this PR implement?
This PR adds mimics both `dapply` with Arrow optimization and Grouped Map Pandas UDF. At Python execution side, it reuses existing `SCALAR_ITER` code path.
Therefore, externally, we don't introduce any new type of Pandas UDF but internally we use another evaluation type code `205` (`SQL_MAP_PANDAS_ITER_UDF`).
This approach is similar with Pandas' Windows function implementation with Grouped Aggregation Pandas UDF functions - internally we have `203` (`SQL_WINDOW_AGG_PANDAS_UDF`) but externally we just share the same `GROUPED_AGG`.
## How was this patch tested?
Manually tested and unittests were added.
Closes #24997 from HyukjinKwon/scalar-udf-iter.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2019-07-01 21:54:16 -04:00
|
|
|
"iterator.")
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
|
2020-07-13 22:22:44 -04:00
|
|
|
if num_output_rows != num_input_rows:
|
2020-04-09 00:14:41 -04:00
|
|
|
raise RuntimeError(
|
|
|
|
"The length of output in Scalar iterator pandas UDF should be "
|
|
|
|
"the same with the input's; however, the length of output was %d and the "
|
2020-07-13 22:22:44 -04:00
|
|
|
"length of input was %d." % (num_output_rows, num_input_rows))
|
[SPARK-26412][PYSPARK][SQL] Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series
## What changes were proposed in this pull request?
Allow Pandas UDF to take an iterator of pd.Series or an iterator of tuple of pd.Series.
Note the UDF input args will be always one iterator:
* if the udf take only column as input, the iterator's element will be pd.Series (corresponding to the column values batch)
* if the udf take multiple columns as inputs, the iterator's element will be a tuple composed of multiple `pd.Series`s, each one corresponding to the multiple columns as inputs (keep the same order). For example:
```
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def the_udf(iterator):
for col1_batch, col2_batch in iterator:
yield col1_batch + col2_batch
df.select(the_udf("col1", "col2"))
```
The udf above will add col1 and col2.
I haven't add unit tests, but manually tests show it works fine. So it is ready for first pass review.
We can test several typical cases:
```
from pyspark.sql import SparkSession
from pyspark.sql.functions import pandas_udf, PandasUDFType
from pyspark.sql.functions import udf
from pyspark.taskcontext import TaskContext
df = spark.createDataFrame([(1, 20), (3, 40)], ["a", "b"])
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi1(it):
pid = TaskContext.get().partitionId()
print("DBG: fi1: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 100
print("DBG: fi1: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi2(it):
pid = TaskContext.get().partitionId()
print("DBG: fi2: do init stuff, partitionId=" + str(pid))
for batch in it:
yield batch + 10000
print("DBG: fi2: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR_ITER)
def fi3(it):
pid = TaskContext.get().partitionId()
print("DBG: fi3: do init stuff, partitionId=" + str(pid))
for x, y in it:
yield x + y * 10 + 100000
print("DBG: fi3: do close stuff, partitionId=" + str(pid))
pandas_udf("int", PandasUDFType.SCALAR)
def fp1(x):
return x + 1000
udf("int")
def fu1(x):
return x + 10
# test select "pandas iter udf/pandas udf/sql udf" expressions at the same time.
# Note this case the `fi1("a"), fi2("b"), fi3("a", "b")` will generate only one plan,
# and `fu1("a")`, `fp1("a")` will generate another two separate plans.
df.select(fi1("a"), fi2("b"), fi3("a", "b"), fu1("a"), fp1("a")).show()
# test chain two pandas iter udf together
# Note this case `fi2(fi1("a"))` will generate only one plan
# Also note the init stuff/close stuff call order will be like:
# (debug output following)
# DBG: fi2: do init stuff, partitionId=0
# DBG: fi1: do init stuff, partitionId=0
# DBG: fi1: do close stuff, partitionId=0
# DBG: fi2: do close stuff, partitionId=0
df.select(fi2(fi1("a"))).show()
# test more complex chain
# Note this case `fi1("a"), fi2("a")` will generate one plan,
# and `fi3(fi1_output, fi2_output)` will generate another plan
df.select(fi3(fi1("a"), fi2("a"))).show()
```
## How was this patch tested?
To be added.
Please review http://spark.apache.org/contributing.html before opening a pull request.
Closes #24643 from WeichenXu123/pandas_udf_iter.
Lead-authored-by: WeichenXu <weichen.xu@databricks.com>
Co-authored-by: Xiangrui Meng <meng@databricks.com>
Signed-off-by: Xiangrui Meng <meng@databricks.com>
2019-06-15 11:29:20 -04:00
|
|
|
|
|
|
|
# profiling is not supported for UDF
|
|
|
|
return func, None, ser, ser
|
|
|
|
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
def extract_key_value_indexes(grouped_arg_offsets):
|
|
|
|
"""
|
|
|
|
Helper function to extract the key and value indexes from arg_offsets for the grouped and
|
|
|
|
cogrouped pandas udfs. See BasePandasGroupExec.resolveArgOffsets for equivalent scala code.
|
|
|
|
|
2020-11-15 20:21:50 -05:00
|
|
|
Parameters
|
|
|
|
----------
|
|
|
|
grouped_arg_offsets: list
|
|
|
|
List containing the key and value indexes of columns of the
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
DataFrames to be passed to the udf. It consists of n repeating groups where n is the
|
|
|
|
number of DataFrames. Each group has the following format:
|
|
|
|
group[0]: length of group
|
|
|
|
group[1]: length of key indexes
|
|
|
|
group[2.. group[1] +2]: key attributes
|
|
|
|
group[group[1] +3 group[0]]: value attributes
|
|
|
|
"""
|
|
|
|
parsed = []
|
|
|
|
idx = 0
|
|
|
|
while idx < len(grouped_arg_offsets):
|
|
|
|
offsets_len = grouped_arg_offsets[idx]
|
|
|
|
idx += 1
|
|
|
|
offsets = grouped_arg_offsets[idx: idx + offsets_len]
|
|
|
|
split_index = offsets[0] + 1
|
|
|
|
offset_keys = offsets[1: split_index]
|
|
|
|
offset_values = offsets[split_index:]
|
|
|
|
parsed.append([offset_keys, offset_values])
|
|
|
|
idx += offsets_len
|
|
|
|
return parsed
|
|
|
|
|
2018-03-08 06:29:07 -05:00
|
|
|
if eval_type == PythonEvalType.SQL_GROUPED_MAP_PANDAS_UDF:
|
|
|
|
# We assume there is only one UDF here because grouped map doesn't
|
|
|
|
# support combining multiple UDFs.
|
|
|
|
assert num_udfs == 1
|
|
|
|
|
|
|
|
# See FlatMapGroupsInPandasExec for how arg_offsets are used to
|
|
|
|
# distinguish between grouping attributes and data attributes
|
2019-11-08 22:19:14 -05:00
|
|
|
arg_offsets, f = read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
parsed_offsets = extract_key_value_indexes(arg_offsets)
|
2019-11-08 22:19:14 -05:00
|
|
|
|
|
|
|
# Create function like this:
|
|
|
|
# mapper a: f([a[0]], [a[0], a[1]])
|
|
|
|
def mapper(a):
|
|
|
|
keys = [a[o] for o in parsed_offsets[0][0]]
|
|
|
|
vals = [a[o] for o in parsed_offsets[0][1]]
|
|
|
|
return f(keys, vals)
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
elif eval_type == PythonEvalType.SQL_COGROUPED_MAP_PANDAS_UDF:
|
|
|
|
# We assume there is only one UDF here because cogrouped map doesn't
|
|
|
|
# support combining multiple UDFs.
|
|
|
|
assert num_udfs == 1
|
2019-11-08 22:19:14 -05:00
|
|
|
arg_offsets, f = read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=0)
|
|
|
|
|
[SPARK-27463][PYTHON] Support Dataframe Cogroup via Pandas UDFs
### What changes were proposed in this pull request?
Adds a new cogroup Pandas UDF. This allows two grouped dataframes to be cogrouped together and apply a (pandas.DataFrame, pandas.DataFrame) -> pandas.DataFrame UDF to each cogroup.
**Example usage**
```
from pyspark.sql.functions import pandas_udf, PandasUDFType
df1 = spark.createDataFrame(
[(20000101, 1, 1.0), (20000101, 2, 2.0), (20000102, 1, 3.0), (20000102, 2, 4.0)],
("time", "id", "v1"))
df2 = spark.createDataFrame(
[(20000101, 1, "x"), (20000101, 2, "y")],
("time", "id", "v2"))
pandas_udf("time int, id int, v1 double, v2 string", PandasUDFType.COGROUPED_MAP)
def asof_join(l, r):
return pd.merge_asof(l, r, on="time", by="id")
df1.groupby("id").cogroup(df2.groupby("id")).apply(asof_join).show()
```
+--------+---+---+---+
| time| id| v1| v2|
+--------+---+---+---+
|20000101| 1|1.0| x|
|20000102| 1|3.0| x|
|20000101| 2|2.0| y|
|20000102| 2|4.0| y|
+--------+---+---+---+
### How was this patch tested?
Added unit test test_pandas_udf_cogrouped_map
Closes #24981 from d80tb7/SPARK-27463-poc-arrow-stream.
Authored-by: Chris Martin <chris@cmartinit.co.uk>
Signed-off-by: Bryan Cutler <cutlerb@gmail.com>
2019-09-17 20:13:50 -04:00
|
|
|
parsed_offsets = extract_key_value_indexes(arg_offsets)
|
2019-11-08 22:19:14 -05:00
|
|
|
|
|
|
|
def mapper(a):
|
|
|
|
df1_keys = [a[0][o] for o in parsed_offsets[0][0]]
|
|
|
|
df1_vals = [a[0][o] for o in parsed_offsets[0][1]]
|
|
|
|
df2_keys = [a[1][o] for o in parsed_offsets[1][0]]
|
|
|
|
df2_vals = [a[1][o] for o in parsed_offsets[1][1]]
|
|
|
|
return f(df1_keys, df1_vals, df2_keys, df2_vals)
|
2018-03-08 06:29:07 -05:00
|
|
|
else:
|
2019-11-08 22:19:14 -05:00
|
|
|
udfs = []
|
2018-03-08 06:29:07 -05:00
|
|
|
for i in range(num_udfs):
|
2019-11-08 22:19:14 -05:00
|
|
|
udfs.append(read_single_udf(pickleSer, infile, eval_type, runner_conf, udf_index=i))
|
|
|
|
|
|
|
|
def mapper(a):
|
|
|
|
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
|
|
|
|
# In the special case of a single UDF this will return a single result rather
|
|
|
|
# than a tuple of results; this is the format that the JVM side expects.
|
|
|
|
if len(result) == 1:
|
|
|
|
return result[0]
|
|
|
|
else:
|
|
|
|
return result
|
|
|
|
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
func = lambda _, it: map(mapper, it)
|
2017-09-22 04:17:41 -04:00
|
|
|
|
[SPARK-14267] [SQL] [PYSPARK] execute multiple Python UDFs within single batch
## What changes were proposed in this pull request?
This PR support multiple Python UDFs within single batch, also improve the performance.
```python
>>> from pyspark.sql.types import IntegerType
>>> sqlContext.registerFunction("double", lambda x: x * 2, IntegerType())
>>> sqlContext.registerFunction("add", lambda x, y: x + y, IntegerType())
>>> sqlContext.sql("SELECT double(add(1, 2)), add(double(2), 1)").explain(True)
== Parsed Logical Plan ==
'Project [unresolvedalias('double('add(1, 2)), None),unresolvedalias('add('double(2), 1), None)]
+- OneRowRelation$
== Analyzed Logical Plan ==
double(add(1, 2)): int, add(double(2), 1): int
Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [double(add(1, 2))#14,add(double(2), 1)#15]
+- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Optimized Logical Plan ==
Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
+- EvaluatePython [add(pythonUDF1#17, 1)], [pythonUDF0#18]
+- EvaluatePython [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- OneRowRelation$
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF0#16 AS double(add(1, 2))#14,pythonUDF0#18 AS add(double(2), 1)#15]
: +- INPUT
+- !BatchPythonEvaluation [add(pythonUDF1#17, 1)], [pythonUDF0#16,pythonUDF1#17,pythonUDF0#18]
+- !BatchPythonEvaluation [double(add(1, 2)),double(2)], [pythonUDF0#16,pythonUDF1#17]
+- Scan OneRowRelation[]
```
## How was this patch tested?
Added new tests.
Using the following script to benchmark 1, 2 and 3 udfs,
```
df = sqlContext.range(1, 1 << 23, 1, 4)
double = F.udf(lambda x: x * 2, LongType())
print df.select(double(df.id)).count()
print df.select(double(df.id), double(df.id + 1)).count()
print df.select(double(df.id), double(df.id + 1), double(df.id + 2)).count()
```
Here is the results:
N | Before | After | speed up
---- |------------ | -------------|------
1 | 22 s | 7 s | 3.1X
2 | 38 s | 13 s | 2.9X
3 | 58 s | 16 s | 3.6X
This benchmark ran locally with 4 CPUs. For 3 UDFs, it launched 12 Python before before this patch, 4 process after this patch. After this patch, it will use less memory for multiple UDFs than before (less buffering).
Author: Davies Liu <davies@databricks.com>
Closes #12057 from davies/multi_udfs.
2016-03-31 19:40:20 -04:00
|
|
|
# profiling is not supported for UDF
|
|
|
|
return func, None, ser, ser
|
[SPARK-14215] [SQL] [PYSPARK] Support chained Python UDFs
## What changes were proposed in this pull request?
This PR brings the support for chained Python UDFs, for example
```sql
select udf1(udf2(a))
select udf1(udf2(a) + 3)
select udf1(udf2(a) + udf3(b))
```
Also directly chained unary Python UDFs are put in single batch of Python UDFs, others may require multiple batches.
For example,
```python
>>> sqlContext.sql("select double(double(1))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#10 AS double(double(1))#9]
: +- INPUT
+- !BatchPythonEvaluation double(double(1)), [pythonUDF#10]
+- Scan OneRowRelation[]
>>> sqlContext.sql("select double(double(1) + double(2))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#19 AS double((double(1) + double(2)))#16]
: +- INPUT
+- !BatchPythonEvaluation double((pythonUDF#17 + pythonUDF#18)), [pythonUDF#17,pythonUDF#18,pythonUDF#19]
+- !BatchPythonEvaluation double(2), [pythonUDF#17,pythonUDF#18]
+- !BatchPythonEvaluation double(1), [pythonUDF#17]
+- Scan OneRowRelation[]
```
TODO: will support multiple unrelated Python UDFs in one batch (another PR).
## How was this patch tested?
Added new unit tests for chained UDFs.
Author: Davies Liu <davies@databricks.com>
Closes #12014 from davies/py_udfs.
2016-03-29 18:06:29 -04:00
|
|
|
|
|
|
|
|
2013-05-06 19:34:30 -04:00
|
|
|
def main(infile, outfile):
|
2021-07-08 22:30:39 -04:00
|
|
|
faulthandler_log_path = os.environ.get("PYTHON_FAULTHANDLER_DIR", None)
|
2014-02-26 17:50:37 -05:00
|
|
|
try:
|
2021-07-08 22:30:39 -04:00
|
|
|
if faulthandler_log_path:
|
|
|
|
faulthandler_log_path = os.path.join(faulthandler_log_path, str(os.getpid()))
|
|
|
|
faulthandler_log_file = open(faulthandler_log_path, "w")
|
|
|
|
faulthandler.enable(file=faulthandler_log_file)
|
|
|
|
|
2014-02-26 17:50:37 -05:00
|
|
|
boot_time = time.time()
|
|
|
|
split_index = read_int(infile)
|
|
|
|
if split_index == -1: # for unit tests
|
2018-03-08 06:38:34 -05:00
|
|
|
sys.exit(-1)
|
2013-08-15 19:01:19 -04:00
|
|
|
|
2015-05-18 15:55:13 -04:00
|
|
|
version = utf8_deserializer.loads(infile)
|
|
|
|
if version != "%d.%d" % sys.version_info[:2]:
|
2021-05-25 22:54:40 -04:00
|
|
|
raise RuntimeError(("Python in worker has different version %s than that in " +
|
|
|
|
"driver %s, PySpark cannot run with different minor versions. " +
|
|
|
|
"Please check environment variables PYSPARK_PYTHON and " +
|
|
|
|
"PYSPARK_DRIVER_PYTHON are correctly set.") %
|
|
|
|
("%d.%d" % sys.version_info[:2], version))
|
2015-05-18 15:55:13 -04:00
|
|
|
|
2018-08-21 18:54:30 -04:00
|
|
|
# read inputs only for a barrier task
|
|
|
|
isBarrier = read_bool(infile)
|
|
|
|
boundPort = read_int(infile)
|
|
|
|
secret = UTF8Deserializer().loads(infile)
|
[SPARK-25004][CORE] Add spark.executor.pyspark.memory limit.
## What changes were proposed in this pull request?
This adds `spark.executor.pyspark.memory` to configure Python's address space limit, [`resource.RLIMIT_AS`](https://docs.python.org/3/library/resource.html#resource.RLIMIT_AS). Limiting Python's address space allows Python to participate in memory management. In practice, we see fewer cases of Python taking too much memory because it doesn't know to run garbage collection. This results in YARN killing fewer containers. This also improves error messages so users know that Python is consuming too much memory:
```
File "build/bdist.linux-x86_64/egg/package/library.py", line 265, in fe_engineer
fe_eval_rec.update(f(src_rec_prep, mat_rec_prep))
File "build/bdist.linux-x86_64/egg/package/library.py", line 163, in fe_comp
comparisons = EvaluationUtils.leven_list_compare(src_rec_prep.get(item, []), mat_rec_prep.get(item, []))
File "build/bdist.linux-x86_64/egg/package/evaluationutils.py", line 25, in leven_list_compare
permutations = sorted(permutations, reverse=True)
MemoryError
```
The new pyspark memory setting is used to increase requested YARN container memory, instead of sharing overhead memory between python and off-heap JVM activity.
## How was this patch tested?
Tested memory limits in our YARN cluster and verified that MemoryError is thrown.
Author: Ryan Blue <blue@apache.org>
Closes #21977 from rdblue/SPARK-25004-add-python-memory-limit.
2018-08-28 15:31:33 -04:00
|
|
|
|
|
|
|
# set up memory limits
|
|
|
|
memory_limit_mb = int(os.environ.get('PYSPARK_EXECUTOR_MEMORY_MB', "-1"))
|
2018-12-02 04:41:08 -05:00
|
|
|
if memory_limit_mb > 0 and has_resource_module:
|
|
|
|
total_memory = resource.RLIMIT_AS
|
|
|
|
try:
|
[SPARK-25004][CORE] Add spark.executor.pyspark.memory limit.
## What changes were proposed in this pull request?
This adds `spark.executor.pyspark.memory` to configure Python's address space limit, [`resource.RLIMIT_AS`](https://docs.python.org/3/library/resource.html#resource.RLIMIT_AS). Limiting Python's address space allows Python to participate in memory management. In practice, we see fewer cases of Python taking too much memory because it doesn't know to run garbage collection. This results in YARN killing fewer containers. This also improves error messages so users know that Python is consuming too much memory:
```
File "build/bdist.linux-x86_64/egg/package/library.py", line 265, in fe_engineer
fe_eval_rec.update(f(src_rec_prep, mat_rec_prep))
File "build/bdist.linux-x86_64/egg/package/library.py", line 163, in fe_comp
comparisons = EvaluationUtils.leven_list_compare(src_rec_prep.get(item, []), mat_rec_prep.get(item, []))
File "build/bdist.linux-x86_64/egg/package/evaluationutils.py", line 25, in leven_list_compare
permutations = sorted(permutations, reverse=True)
MemoryError
```
The new pyspark memory setting is used to increase requested YARN container memory, instead of sharing overhead memory between python and off-heap JVM activity.
## How was this patch tested?
Tested memory limits in our YARN cluster and verified that MemoryError is thrown.
Author: Ryan Blue <blue@apache.org>
Closes #21977 from rdblue/SPARK-25004-add-python-memory-limit.
2018-08-28 15:31:33 -04:00
|
|
|
(soft_limit, hard_limit) = resource.getrlimit(total_memory)
|
|
|
|
msg = "Current mem limits: {0} of max {1}\n".format(soft_limit, hard_limit)
|
|
|
|
print(msg, file=sys.stderr)
|
|
|
|
|
|
|
|
# convert to bytes
|
|
|
|
new_limit = memory_limit_mb * 1024 * 1024
|
|
|
|
|
|
|
|
if soft_limit == resource.RLIM_INFINITY or new_limit < soft_limit:
|
|
|
|
msg = "Setting mem limits to {0} of max {1}\n".format(new_limit, new_limit)
|
|
|
|
print(msg, file=sys.stderr)
|
|
|
|
resource.setrlimit(total_memory, (new_limit, new_limit))
|
|
|
|
|
2018-12-02 04:41:08 -05:00
|
|
|
except (resource.error, OSError, ValueError) as e:
|
|
|
|
# not all systems support resource limits, so warn instead of failing
|
2021-01-19 01:30:42 -05:00
|
|
|
lineno = getframeinfo(
|
|
|
|
currentframe()).lineno + 1 if currentframe() is not None else 0
|
2021-01-17 19:32:55 -05:00
|
|
|
print(warnings.formatwarning(
|
|
|
|
"Failed to set memory limit: {0}".format(e),
|
|
|
|
ResourceWarning,
|
|
|
|
__file__,
|
2021-01-19 01:30:42 -05:00
|
|
|
lineno
|
2021-01-17 19:32:55 -05:00
|
|
|
), file=sys.stderr)
|
[SPARK-25004][CORE] Add spark.executor.pyspark.memory limit.
## What changes were proposed in this pull request?
This adds `spark.executor.pyspark.memory` to configure Python's address space limit, [`resource.RLIMIT_AS`](https://docs.python.org/3/library/resource.html#resource.RLIMIT_AS). Limiting Python's address space allows Python to participate in memory management. In practice, we see fewer cases of Python taking too much memory because it doesn't know to run garbage collection. This results in YARN killing fewer containers. This also improves error messages so users know that Python is consuming too much memory:
```
File "build/bdist.linux-x86_64/egg/package/library.py", line 265, in fe_engineer
fe_eval_rec.update(f(src_rec_prep, mat_rec_prep))
File "build/bdist.linux-x86_64/egg/package/library.py", line 163, in fe_comp
comparisons = EvaluationUtils.leven_list_compare(src_rec_prep.get(item, []), mat_rec_prep.get(item, []))
File "build/bdist.linux-x86_64/egg/package/evaluationutils.py", line 25, in leven_list_compare
permutations = sorted(permutations, reverse=True)
MemoryError
```
The new pyspark memory setting is used to increase requested YARN container memory, instead of sharing overhead memory between python and off-heap JVM activity.
## How was this patch tested?
Tested memory limits in our YARN cluster and verified that MemoryError is thrown.
Author: Ryan Blue <blue@apache.org>
Closes #21977 from rdblue/SPARK-25004-add-python-memory-limit.
2018-08-28 15:31:33 -04:00
|
|
|
|
2014-09-14 01:31:21 -04:00
|
|
|
# initialize global state
|
2018-08-21 18:54:30 -04:00
|
|
|
taskContext = None
|
|
|
|
if isBarrier:
|
|
|
|
taskContext = BarrierTaskContext._getOrCreate()
|
|
|
|
BarrierTaskContext._initialize(boundPort, secret)
|
2019-10-31 00:10:44 -04:00
|
|
|
# Set the task context instance here, so we can get it by TaskContext.get for
|
|
|
|
# both TaskContext and BarrierTaskContext
|
|
|
|
TaskContext._setTaskContext(taskContext)
|
2018-08-21 18:54:30 -04:00
|
|
|
else:
|
|
|
|
taskContext = TaskContext._getOrCreate()
|
|
|
|
# read inputs for TaskContext info
|
2016-12-20 18:51:21 -05:00
|
|
|
taskContext._stageId = read_int(infile)
|
|
|
|
taskContext._partitionId = read_int(infile)
|
|
|
|
taskContext._attemptNumber = read_int(infile)
|
|
|
|
taskContext._taskAttemptId = read_long(infile)
|
2021-08-04 22:14:01 -04:00
|
|
|
taskContext._cpus = read_int(infile)
|
2019-07-10 20:32:58 -04:00
|
|
|
taskContext._resources = {}
|
|
|
|
for r in range(read_int(infile)):
|
|
|
|
key = utf8_deserializer.loads(infile)
|
|
|
|
name = utf8_deserializer.loads(infile)
|
|
|
|
addresses = []
|
|
|
|
taskContext._resources = {}
|
|
|
|
for a in range(read_int(infile)):
|
|
|
|
addresses.append(utf8_deserializer.loads(infile))
|
|
|
|
taskContext._resources[key] = ResourceInformation(name, addresses)
|
|
|
|
|
2018-05-31 14:23:57 -04:00
|
|
|
taskContext._localProperties = dict()
|
|
|
|
for i in range(read_int(infile)):
|
|
|
|
k = utf8_deserializer.loads(infile)
|
|
|
|
v = utf8_deserializer.loads(infile)
|
|
|
|
taskContext._localProperties[k] = v
|
|
|
|
|
2014-09-14 01:31:21 -04:00
|
|
|
shuffle.MemoryBytesSpilled = 0
|
|
|
|
shuffle.DiskBytesSpilled = 0
|
|
|
|
_accumulatorRegistry.clear()
|
|
|
|
|
2014-02-26 17:50:37 -05:00
|
|
|
# fetch name of workdir
|
|
|
|
spark_files_dir = utf8_deserializer.loads(infile)
|
|
|
|
SparkFiles._root_directory = spark_files_dir
|
|
|
|
SparkFiles._is_running_on_worker = True
|
2013-08-15 19:01:19 -04:00
|
|
|
|
2014-02-26 17:50:37 -05:00
|
|
|
# fetch names of includes (*.zip and *.egg files) and construct PYTHONPATH
|
2014-09-24 15:10:09 -04:00
|
|
|
add_path(spark_files_dir) # *.py files that were added will be copied here
|
2014-07-22 01:30:53 -04:00
|
|
|
num_python_includes = read_int(infile)
|
2014-02-26 17:50:37 -05:00
|
|
|
for _ in range(num_python_includes):
|
|
|
|
filename = utf8_deserializer.loads(infile)
|
2014-09-24 15:10:09 -04:00
|
|
|
add_path(os.path.join(spark_files_dir, filename))
|
2020-07-13 22:22:44 -04:00
|
|
|
|
|
|
|
importlib.invalidate_caches()
|
2013-08-15 19:01:19 -04:00
|
|
|
|
2014-05-10 16:02:13 -04:00
|
|
|
# fetch names and values of broadcast variables
|
2018-08-13 22:35:34 -04:00
|
|
|
needs_broadcast_decryption_server = read_bool(infile)
|
2014-05-10 16:02:13 -04:00
|
|
|
num_broadcast_variables = read_int(infile)
|
2018-08-13 22:35:34 -04:00
|
|
|
if needs_broadcast_decryption_server:
|
|
|
|
# read the decrypted data from a server in the jvm
|
|
|
|
port = read_int(infile)
|
|
|
|
auth_secret = utf8_deserializer.loads(infile)
|
|
|
|
(broadcast_sock_file, _) = local_connect_and_auth(port, auth_secret)
|
|
|
|
|
2014-05-10 16:02:13 -04:00
|
|
|
for _ in range(num_broadcast_variables):
|
|
|
|
bid = read_long(infile)
|
2014-09-13 19:22:04 -04:00
|
|
|
if bid >= 0:
|
2018-08-13 22:35:34 -04:00
|
|
|
if needs_broadcast_decryption_server:
|
|
|
|
read_bid = read_long(broadcast_sock_file)
|
|
|
|
assert(read_bid == bid)
|
|
|
|
_broadcastRegistry[bid] = \
|
|
|
|
Broadcast(sock_file=broadcast_sock_file)
|
|
|
|
else:
|
|
|
|
path = utf8_deserializer.loads(infile)
|
|
|
|
_broadcastRegistry[bid] = Broadcast(path=path)
|
|
|
|
|
2014-09-13 19:22:04 -04:00
|
|
|
else:
|
|
|
|
bid = - bid - 1
|
2014-09-18 21:11:48 -04:00
|
|
|
_broadcastRegistry.pop(bid)
|
2014-05-10 16:02:13 -04:00
|
|
|
|
2018-08-13 22:35:34 -04:00
|
|
|
if needs_broadcast_decryption_server:
|
|
|
|
broadcast_sock_file.write(b'1')
|
|
|
|
broadcast_sock_file.close()
|
|
|
|
|
2014-09-13 19:22:04 -04:00
|
|
|
_accumulatorRegistry.clear()
|
2017-09-22 04:17:41 -04:00
|
|
|
eval_type = read_int(infile)
|
|
|
|
if eval_type == PythonEvalType.NON_UDF:
|
[SPARK-14215] [SQL] [PYSPARK] Support chained Python UDFs
## What changes were proposed in this pull request?
This PR brings the support for chained Python UDFs, for example
```sql
select udf1(udf2(a))
select udf1(udf2(a) + 3)
select udf1(udf2(a) + udf3(b))
```
Also directly chained unary Python UDFs are put in single batch of Python UDFs, others may require multiple batches.
For example,
```python
>>> sqlContext.sql("select double(double(1))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#10 AS double(double(1))#9]
: +- INPUT
+- !BatchPythonEvaluation double(double(1)), [pythonUDF#10]
+- Scan OneRowRelation[]
>>> sqlContext.sql("select double(double(1) + double(2))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#19 AS double((double(1) + double(2)))#16]
: +- INPUT
+- !BatchPythonEvaluation double((pythonUDF#17 + pythonUDF#18)), [pythonUDF#17,pythonUDF#18,pythonUDF#19]
+- !BatchPythonEvaluation double(2), [pythonUDF#17,pythonUDF#18]
+- !BatchPythonEvaluation double(1), [pythonUDF#17]
+- Scan OneRowRelation[]
```
TODO: will support multiple unrelated Python UDFs in one batch (another PR).
## How was this patch tested?
Added new unit tests for chained UDFs.
Author: Davies Liu <davies@databricks.com>
Closes #12014 from davies/py_udfs.
2016-03-29 18:06:29 -04:00
|
|
|
func, profiler, deserializer, serializer = read_command(pickleSer, infile)
|
2017-09-22 04:17:41 -04:00
|
|
|
else:
|
|
|
|
func, profiler, deserializer, serializer = read_udfs(pickleSer, infile, eval_type)
|
[SPARK-14215] [SQL] [PYSPARK] Support chained Python UDFs
## What changes were proposed in this pull request?
This PR brings the support for chained Python UDFs, for example
```sql
select udf1(udf2(a))
select udf1(udf2(a) + 3)
select udf1(udf2(a) + udf3(b))
```
Also directly chained unary Python UDFs are put in single batch of Python UDFs, others may require multiple batches.
For example,
```python
>>> sqlContext.sql("select double(double(1))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#10 AS double(double(1))#9]
: +- INPUT
+- !BatchPythonEvaluation double(double(1)), [pythonUDF#10]
+- Scan OneRowRelation[]
>>> sqlContext.sql("select double(double(1) + double(2))").explain()
== Physical Plan ==
WholeStageCodegen
: +- Project [pythonUDF#19 AS double((double(1) + double(2)))#16]
: +- INPUT
+- !BatchPythonEvaluation double((pythonUDF#17 + pythonUDF#18)), [pythonUDF#17,pythonUDF#18,pythonUDF#19]
+- !BatchPythonEvaluation double(2), [pythonUDF#17,pythonUDF#18]
+- !BatchPythonEvaluation double(1), [pythonUDF#17]
+- Scan OneRowRelation[]
```
TODO: will support multiple unrelated Python UDFs in one batch (another PR).
## How was this patch tested?
Added new unit tests for chained UDFs.
Author: Davies Liu <davies@databricks.com>
Closes #12014 from davies/py_udfs.
2016-03-29 18:06:29 -04:00
|
|
|
|
2014-02-26 17:50:37 -05:00
|
|
|
init_time = time.time()
|
[SPARK-3478] [PySpark] Profile the Python tasks
This patch add profiling support for PySpark, it will show the profiling results
before the driver exits, here is one example:
```
============================================================
Profile of RDD<id=3>
============================================================
5146507 function calls (5146487 primitive calls) in 71.094 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
5144576 68.331 0.000 68.331 0.000 statcounter.py:44(merge)
20 2.735 0.137 71.071 3.554 statcounter.py:33(__init__)
20 0.017 0.001 0.017 0.001 {cPickle.dumps}
1024 0.003 0.000 0.003 0.000 t.py:16(<lambda>)
20 0.001 0.000 0.001 0.000 {reduce}
21 0.001 0.000 0.001 0.000 {cPickle.loads}
20 0.001 0.000 0.001 0.000 copy_reg.py:95(_slotnames)
41 0.001 0.000 0.001 0.000 serializers.py:461(read_int)
40 0.001 0.000 0.002 0.000 serializers.py:179(_batched)
62 0.000 0.000 0.000 0.000 {method 'read' of 'file' objects}
20 0.000 0.000 71.072 3.554 rdd.py:863(<lambda>)
20 0.000 0.000 0.001 0.000 serializers.py:198(load_stream)
40/20 0.000 0.000 71.072 3.554 rdd.py:2093(pipeline_func)
41 0.000 0.000 0.002 0.000 serializers.py:130(load_stream)
40 0.000 0.000 71.072 1.777 rdd.py:304(func)
20 0.000 0.000 71.094 3.555 worker.py:82(process)
```
Also, use can show profile result manually by `sc.show_profiles()` or dump it into disk
by `sc.dump_profiles(path)`, such as
```python
>>> sc._conf.set("spark.python.profile", "true")
>>> rdd = sc.parallelize(range(100)).map(str)
>>> rdd.count()
100
>>> sc.show_profiles()
============================================================
Profile of RDD<id=1>
============================================================
284 function calls (276 primitive calls) in 0.001 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
4 0.000 0.000 0.000 0.000 serializers.py:198(load_stream)
4 0.000 0.000 0.000 0.000 {reduce}
12/4 0.000 0.000 0.001 0.000 rdd.py:2092(pipeline_func)
4 0.000 0.000 0.000 0.000 {cPickle.loads}
4 0.000 0.000 0.000 0.000 {cPickle.dumps}
104 0.000 0.000 0.000 0.000 rdd.py:852(<genexpr>)
8 0.000 0.000 0.000 0.000 serializers.py:461(read_int)
12 0.000 0.000 0.000 0.000 rdd.py:303(func)
```
The profiling is disabled by default, can be enabled by "spark.python.profile=true".
Also, users can dump the results into disks automatically for future analysis, by "spark.python.profile.dump=path_to_dump"
This is bugfix of #2351 cc JoshRosen
Author: Davies Liu <davies.liu@gmail.com>
Closes #2556 from davies/profiler and squashes the following commits:
e68df5a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
858e74c [Davies Liu] compatitable with python 2.6
7ef2aa0 [Davies Liu] bugfix, add tests for show_profiles and dump_profiles()
2b0daf2 [Davies Liu] fix docs
7a56c24 [Davies Liu] bugfix
cba9463 [Davies Liu] move show_profiles and dump_profiles to SparkContext
fb9565b [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
116d52a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
09d02c3 [Davies Liu] Merge branch 'master' into profiler
c23865c [Davies Liu] Merge branch 'master' into profiler
15d6f18 [Davies Liu] add docs for two configs
dadee1a [Davies Liu] add docs string and clear profiles after show or dump
4f8309d [Davies Liu] address comment, add tests
0a5b6eb [Davies Liu] fix Python UDF
4b20494 [Davies Liu] add profile for python
2014-09-30 21:24:57 -04:00
|
|
|
|
|
|
|
def process():
|
|
|
|
iterator = deserializer.load_stream(infile)
|
2019-06-28 04:10:25 -04:00
|
|
|
out_iter = func(split_index, iterator)
|
|
|
|
try:
|
|
|
|
serializer.dump_stream(out_iter, outfile)
|
|
|
|
finally:
|
|
|
|
if hasattr(out_iter, 'close'):
|
|
|
|
out_iter.close()
|
[SPARK-3478] [PySpark] Profile the Python tasks
This patch add profiling support for PySpark, it will show the profiling results
before the driver exits, here is one example:
```
============================================================
Profile of RDD<id=3>
============================================================
5146507 function calls (5146487 primitive calls) in 71.094 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
5144576 68.331 0.000 68.331 0.000 statcounter.py:44(merge)
20 2.735 0.137 71.071 3.554 statcounter.py:33(__init__)
20 0.017 0.001 0.017 0.001 {cPickle.dumps}
1024 0.003 0.000 0.003 0.000 t.py:16(<lambda>)
20 0.001 0.000 0.001 0.000 {reduce}
21 0.001 0.000 0.001 0.000 {cPickle.loads}
20 0.001 0.000 0.001 0.000 copy_reg.py:95(_slotnames)
41 0.001 0.000 0.001 0.000 serializers.py:461(read_int)
40 0.001 0.000 0.002 0.000 serializers.py:179(_batched)
62 0.000 0.000 0.000 0.000 {method 'read' of 'file' objects}
20 0.000 0.000 71.072 3.554 rdd.py:863(<lambda>)
20 0.000 0.000 0.001 0.000 serializers.py:198(load_stream)
40/20 0.000 0.000 71.072 3.554 rdd.py:2093(pipeline_func)
41 0.000 0.000 0.002 0.000 serializers.py:130(load_stream)
40 0.000 0.000 71.072 1.777 rdd.py:304(func)
20 0.000 0.000 71.094 3.555 worker.py:82(process)
```
Also, use can show profile result manually by `sc.show_profiles()` or dump it into disk
by `sc.dump_profiles(path)`, such as
```python
>>> sc._conf.set("spark.python.profile", "true")
>>> rdd = sc.parallelize(range(100)).map(str)
>>> rdd.count()
100
>>> sc.show_profiles()
============================================================
Profile of RDD<id=1>
============================================================
284 function calls (276 primitive calls) in 0.001 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
4 0.000 0.000 0.000 0.000 serializers.py:198(load_stream)
4 0.000 0.000 0.000 0.000 {reduce}
12/4 0.000 0.000 0.001 0.000 rdd.py:2092(pipeline_func)
4 0.000 0.000 0.000 0.000 {cPickle.loads}
4 0.000 0.000 0.000 0.000 {cPickle.dumps}
104 0.000 0.000 0.000 0.000 rdd.py:852(<genexpr>)
8 0.000 0.000 0.000 0.000 serializers.py:461(read_int)
12 0.000 0.000 0.000 0.000 rdd.py:303(func)
```
The profiling is disabled by default, can be enabled by "spark.python.profile=true".
Also, users can dump the results into disks automatically for future analysis, by "spark.python.profile.dump=path_to_dump"
This is bugfix of #2351 cc JoshRosen
Author: Davies Liu <davies.liu@gmail.com>
Closes #2556 from davies/profiler and squashes the following commits:
e68df5a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
858e74c [Davies Liu] compatitable with python 2.6
7ef2aa0 [Davies Liu] bugfix, add tests for show_profiles and dump_profiles()
2b0daf2 [Davies Liu] fix docs
7a56c24 [Davies Liu] bugfix
cba9463 [Davies Liu] move show_profiles and dump_profiles to SparkContext
fb9565b [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
116d52a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
09d02c3 [Davies Liu] Merge branch 'master' into profiler
c23865c [Davies Liu] Merge branch 'master' into profiler
15d6f18 [Davies Liu] add docs for two configs
dadee1a [Davies Liu] add docs string and clear profiles after show or dump
4f8309d [Davies Liu] address comment, add tests
0a5b6eb [Davies Liu] fix Python UDF
4b20494 [Davies Liu] add profile for python
2014-09-30 21:24:57 -04:00
|
|
|
|
2015-01-28 16:48:06 -05:00
|
|
|
if profiler:
|
|
|
|
profiler.profile(process)
|
[SPARK-3478] [PySpark] Profile the Python tasks
This patch add profiling support for PySpark, it will show the profiling results
before the driver exits, here is one example:
```
============================================================
Profile of RDD<id=3>
============================================================
5146507 function calls (5146487 primitive calls) in 71.094 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
5144576 68.331 0.000 68.331 0.000 statcounter.py:44(merge)
20 2.735 0.137 71.071 3.554 statcounter.py:33(__init__)
20 0.017 0.001 0.017 0.001 {cPickle.dumps}
1024 0.003 0.000 0.003 0.000 t.py:16(<lambda>)
20 0.001 0.000 0.001 0.000 {reduce}
21 0.001 0.000 0.001 0.000 {cPickle.loads}
20 0.001 0.000 0.001 0.000 copy_reg.py:95(_slotnames)
41 0.001 0.000 0.001 0.000 serializers.py:461(read_int)
40 0.001 0.000 0.002 0.000 serializers.py:179(_batched)
62 0.000 0.000 0.000 0.000 {method 'read' of 'file' objects}
20 0.000 0.000 71.072 3.554 rdd.py:863(<lambda>)
20 0.000 0.000 0.001 0.000 serializers.py:198(load_stream)
40/20 0.000 0.000 71.072 3.554 rdd.py:2093(pipeline_func)
41 0.000 0.000 0.002 0.000 serializers.py:130(load_stream)
40 0.000 0.000 71.072 1.777 rdd.py:304(func)
20 0.000 0.000 71.094 3.555 worker.py:82(process)
```
Also, use can show profile result manually by `sc.show_profiles()` or dump it into disk
by `sc.dump_profiles(path)`, such as
```python
>>> sc._conf.set("spark.python.profile", "true")
>>> rdd = sc.parallelize(range(100)).map(str)
>>> rdd.count()
100
>>> sc.show_profiles()
============================================================
Profile of RDD<id=1>
============================================================
284 function calls (276 primitive calls) in 0.001 seconds
Ordered by: internal time, cumulative time
ncalls tottime percall cumtime percall filename:lineno(function)
4 0.000 0.000 0.000 0.000 serializers.py:198(load_stream)
4 0.000 0.000 0.000 0.000 {reduce}
12/4 0.000 0.000 0.001 0.000 rdd.py:2092(pipeline_func)
4 0.000 0.000 0.000 0.000 {cPickle.loads}
4 0.000 0.000 0.000 0.000 {cPickle.dumps}
104 0.000 0.000 0.000 0.000 rdd.py:852(<genexpr>)
8 0.000 0.000 0.000 0.000 serializers.py:461(read_int)
12 0.000 0.000 0.000 0.000 rdd.py:303(func)
```
The profiling is disabled by default, can be enabled by "spark.python.profile=true".
Also, users can dump the results into disks automatically for future analysis, by "spark.python.profile.dump=path_to_dump"
This is bugfix of #2351 cc JoshRosen
Author: Davies Liu <davies.liu@gmail.com>
Closes #2556 from davies/profiler and squashes the following commits:
e68df5a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
858e74c [Davies Liu] compatitable with python 2.6
7ef2aa0 [Davies Liu] bugfix, add tests for show_profiles and dump_profiles()
2b0daf2 [Davies Liu] fix docs
7a56c24 [Davies Liu] bugfix
cba9463 [Davies Liu] move show_profiles and dump_profiles to SparkContext
fb9565b [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
116d52a [Davies Liu] Merge branch 'master' of github.com:apache/spark into profiler
09d02c3 [Davies Liu] Merge branch 'master' into profiler
c23865c [Davies Liu] Merge branch 'master' into profiler
15d6f18 [Davies Liu] add docs for two configs
dadee1a [Davies Liu] add docs string and clear profiles after show or dump
4f8309d [Davies Liu] address comment, add tests
0a5b6eb [Davies Liu] fix Python UDF
4b20494 [Davies Liu] add profile for python
2014-09-30 21:24:57 -04:00
|
|
|
else:
|
|
|
|
process()
|
2019-10-31 00:10:44 -04:00
|
|
|
|
|
|
|
# Reset task context to None. This is a guard code to avoid residual context when worker
|
|
|
|
# reuse.
|
|
|
|
TaskContext._setTaskContext(None)
|
|
|
|
BarrierTaskContext._setTaskContext(None)
|
[SPARK-33407][PYTHON] Simplify the exception message from Python UDFs (disabled by default)
### What changes were proposed in this pull request?
This PR proposes to simplify the exception messages from Python UDFS.
Currently, the exception message from Python UDFs is as below:
```python
from pyspark.sql.functions import udf; spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 605, in main
process()
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 597, in process
serializer.dump_stream(out_iter, outfile)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 223, in dump_stream
self.serializer.dump_stream(self._batched(iterator), stream)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 141, in dump_stream
for obj in iterator:
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 212, in _batched
for item in iterator:
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in mapper
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in <genexpr>
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 90, in <lambda>
return lambda *a: f(*a)
File "/.../python/lib/pyspark.zip/pyspark/util.py", line 107, in wrapper
return f(*args, **kwargs)
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
Actually, almost all cases, users only care about `ZeroDivisionError: division by zero`. We don't really have to show the internal stuff in 99% cases.
This PR adds a configuration `spark.sql.execution.pyspark.udf.simplifiedException.enabled` (disabled by default) that hides the internal tracebacks related to Python worker, (de)serialization, etc.
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
The trackback will be shown from the point when any non-PySpark file is seen in the traceback.
### Why are the changes needed?
Without this configuration. such internal tracebacks are exposed to users directly especially for shall or notebook users in PySpark. 99% cases people don't care about the internal Python worker, (de)serialization and related tracebacks. It just makes the exception more difficult to read. For example, one statement of `x/0` above shows a very long traceback and most of them are unnecessary.
This configuration enables the ability to show simplified tracebacks which users will likely be most interested in.
### Does this PR introduce _any_ user-facing change?
By default, no. It adds one configuration that simplifies the exception message. See the example above.
### How was this patch tested?
Manually tested:
```bash
$ pyspark --conf spark.sql.execution.pyspark.udf.simplifiedException.enabled=true
```
```python
from pyspark.sql.functions import udf; spark.sparkContext.setLogLevel("FATAL"); spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
and unittests were also added.
Closes #30309 from HyukjinKwon/SPARK-33407.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2020-11-17 00:15:31 -05:00
|
|
|
except BaseException as e:
|
2014-07-29 03:15:45 -04:00
|
|
|
try:
|
[SPARK-33407][PYTHON] Simplify the exception message from Python UDFs (disabled by default)
### What changes were proposed in this pull request?
This PR proposes to simplify the exception messages from Python UDFS.
Currently, the exception message from Python UDFs is as below:
```python
from pyspark.sql.functions import udf; spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 605, in main
process()
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 597, in process
serializer.dump_stream(out_iter, outfile)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 223, in dump_stream
self.serializer.dump_stream(self._batched(iterator), stream)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 141, in dump_stream
for obj in iterator:
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 212, in _batched
for item in iterator:
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in mapper
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in <genexpr>
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 90, in <lambda>
return lambda *a: f(*a)
File "/.../python/lib/pyspark.zip/pyspark/util.py", line 107, in wrapper
return f(*args, **kwargs)
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
Actually, almost all cases, users only care about `ZeroDivisionError: division by zero`. We don't really have to show the internal stuff in 99% cases.
This PR adds a configuration `spark.sql.execution.pyspark.udf.simplifiedException.enabled` (disabled by default) that hides the internal tracebacks related to Python worker, (de)serialization, etc.
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
The trackback will be shown from the point when any non-PySpark file is seen in the traceback.
### Why are the changes needed?
Without this configuration. such internal tracebacks are exposed to users directly especially for shall or notebook users in PySpark. 99% cases people don't care about the internal Python worker, (de)serialization and related tracebacks. It just makes the exception more difficult to read. For example, one statement of `x/0` above shows a very long traceback and most of them are unnecessary.
This configuration enables the ability to show simplified tracebacks which users will likely be most interested in.
### Does this PR introduce _any_ user-facing change?
By default, no. It adds one configuration that simplifies the exception message. See the example above.
### How was this patch tested?
Manually tested:
```bash
$ pyspark --conf spark.sql.execution.pyspark.udf.simplifiedException.enabled=true
```
```python
from pyspark.sql.functions import udf; spark.sparkContext.setLogLevel("FATAL"); spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
and unittests were also added.
Closes #30309 from HyukjinKwon/SPARK-33407.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2020-11-17 00:15:31 -05:00
|
|
|
exc_info = None
|
|
|
|
if os.environ.get("SPARK_SIMPLIFIED_TRACEBACK", False):
|
|
|
|
tb = try_simplify_traceback(sys.exc_info()[-1])
|
|
|
|
if tb is not None:
|
|
|
|
e.__cause__ = None
|
|
|
|
exc_info = "".join(traceback.format_exception(type(e), e, tb))
|
|
|
|
if exc_info is None:
|
|
|
|
exc_info = traceback.format_exc()
|
|
|
|
|
2014-07-29 03:15:45 -04:00
|
|
|
write_int(SpecialLengths.PYTHON_EXCEPTION_THROWN, outfile)
|
[SPARK-33407][PYTHON] Simplify the exception message from Python UDFs (disabled by default)
### What changes were proposed in this pull request?
This PR proposes to simplify the exception messages from Python UDFS.
Currently, the exception message from Python UDFs is as below:
```python
from pyspark.sql.functions import udf; spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 605, in main
process()
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 597, in process
serializer.dump_stream(out_iter, outfile)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 223, in dump_stream
self.serializer.dump_stream(self._batched(iterator), stream)
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 141, in dump_stream
for obj in iterator:
File "/.../python/lib/pyspark.zip/pyspark/serializers.py", line 212, in _batched
for item in iterator:
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in mapper
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 450, in <genexpr>
result = tuple(f(*[a[o] for o in arg_offsets]) for (arg_offsets, f) in udfs)
File "/.../python/lib/pyspark.zip/pyspark/worker.py", line 90, in <lambda>
return lambda *a: f(*a)
File "/.../python/lib/pyspark.zip/pyspark/util.py", line 107, in wrapper
return f(*args, **kwargs)
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
Actually, almost all cases, users only care about `ZeroDivisionError: division by zero`. We don't really have to show the internal stuff in 99% cases.
This PR adds a configuration `spark.sql.execution.pyspark.udf.simplifiedException.enabled` (disabled by default) that hides the internal tracebacks related to Python worker, (de)serialization, etc.
```python
Traceback (most recent call last):
File "<stdin>", line 1, in <module>
File "/.../python/pyspark/sql/dataframe.py", line 427, in show
print(self._jdf.showString(n, 20, vertical))
File "/.../python/lib/py4j-0.10.9-src.zip/py4j/java_gateway.py", line 1305, in __call__
File "/.../python/pyspark/sql/utils.py", line 127, in deco
raise_from(converted)
File "<string>", line 3, in raise_from
pyspark.sql.utils.PythonException:
An exception was thrown from Python worker in the executor:
Traceback (most recent call last):
File "<stdin>", line 1, in <lambda>
ZeroDivisionError: division by zero
```
The trackback will be shown from the point when any non-PySpark file is seen in the traceback.
### Why are the changes needed?
Without this configuration. such internal tracebacks are exposed to users directly especially for shall or notebook users in PySpark. 99% cases people don't care about the internal Python worker, (de)serialization and related tracebacks. It just makes the exception more difficult to read. For example, one statement of `x/0` above shows a very long traceback and most of them are unnecessary.
This configuration enables the ability to show simplified tracebacks which users will likely be most interested in.
### Does this PR introduce _any_ user-facing change?
By default, no. It adds one configuration that simplifies the exception message. See the example above.
### How was this patch tested?
Manually tested:
```bash
$ pyspark --conf spark.sql.execution.pyspark.udf.simplifiedException.enabled=true
```
```python
from pyspark.sql.functions import udf; spark.sparkContext.setLogLevel("FATAL"); spark.range(10).select(udf(lambda x: x/0)("id")).collect()
```
and unittests were also added.
Closes #30309 from HyukjinKwon/SPARK-33407.
Authored-by: HyukjinKwon <gurwls223@apache.org>
Signed-off-by: HyukjinKwon <gurwls223@apache.org>
2020-11-17 00:15:31 -05:00
|
|
|
write_with_length(exc_info.encode("utf-8"), outfile)
|
2014-07-29 03:15:45 -04:00
|
|
|
except IOError:
|
|
|
|
# JVM close the socket
|
|
|
|
pass
|
2020-11-10 05:39:18 -05:00
|
|
|
except BaseException:
|
2014-07-29 03:15:45 -04:00
|
|
|
# Write the error to stderr if it happened while serializing
|
2015-04-16 19:20:57 -04:00
|
|
|
print("PySpark worker failed with exception:", file=sys.stderr)
|
|
|
|
print(traceback.format_exc(), file=sys.stderr)
|
2018-03-08 06:38:34 -05:00
|
|
|
sys.exit(-1)
|
2021-07-08 22:30:39 -04:00
|
|
|
finally:
|
|
|
|
if faulthandler_log_path:
|
|
|
|
faulthandler.disable()
|
|
|
|
faulthandler_log_file.close()
|
|
|
|
os.remove(faulthandler_log_path)
|
2013-03-10 16:54:46 -04:00
|
|
|
finish_time = time.time()
|
2013-05-06 19:34:30 -04:00
|
|
|
report_times(outfile, boot_time, init_time, finish_time)
|
2014-09-14 01:31:21 -04:00
|
|
|
write_long(shuffle.MemoryBytesSpilled, outfile)
|
|
|
|
write_long(shuffle.DiskBytesSpilled, outfile)
|
|
|
|
|
2013-01-20 04:57:44 -05:00
|
|
|
# Mark the beginning of the accumulators section of the output
|
2013-11-03 00:13:18 -04:00
|
|
|
write_int(SpecialLengths.END_OF_DATA_SECTION, outfile)
|
|
|
|
write_int(len(_accumulatorRegistry), outfile)
|
|
|
|
for (aid, accum) in _accumulatorRegistry.items():
|
2013-11-05 20:52:39 -05:00
|
|
|
pickleSer._write_with_length((aid, accum._value), outfile)
|
2012-08-10 04:10:02 -04:00
|
|
|
|
2014-10-23 20:20:00 -04:00
|
|
|
# check end of stream
|
|
|
|
if read_int(infile) == SpecialLengths.END_OF_STREAM:
|
|
|
|
write_int(SpecialLengths.END_OF_STREAM, outfile)
|
|
|
|
else:
|
|
|
|
# write a different value to tell JVM to not reuse this worker
|
|
|
|
write_int(SpecialLengths.END_OF_DATA_SECTION, outfile)
|
2018-03-08 06:38:34 -05:00
|
|
|
sys.exit(-1)
|
2014-10-23 20:20:00 -04:00
|
|
|
|
2012-08-10 04:10:02 -04:00
|
|
|
|
|
|
|
if __name__ == '__main__':
|
2018-04-13 17:28:24 -04:00
|
|
|
# Read information about how to connect back to the JVM from the environment.
|
|
|
|
java_port = int(os.environ["PYTHON_WORKER_FACTORY_PORT"])
|
|
|
|
auth_secret = os.environ["PYTHON_WORKER_FACTORY_SECRET"]
|
2018-08-28 21:47:38 -04:00
|
|
|
(sock_file, _) = local_connect_and_auth(java_port, auth_secret)
|
2021-07-08 22:30:39 -04:00
|
|
|
# TODO: Remove thw following two lines and use `Process.pid()` when we drop JDK 8.
|
|
|
|
write_int(os.getpid(), sock_file)
|
|
|
|
sock_file.flush()
|
2013-09-01 21:06:15 -04:00
|
|
|
main(sock_file, sock_file)
|